Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-11-18 02:03:09 UTC
Update Date2022-08-31 18:30:41 UTC
MiMeDB IDMMDBc0032118
Metabolite Identification
Common Nameγ-L-glutamyl 5-phosphate
Descriptiongamma-L-Glutamyl 5-phosphate is an intermediate in L-proline biosynthesis I pathway in E.coli. It is a product for the enzyme gamma-glutamyl kinase which catalyzes the reaction L-glutamate + ATP -> gamma-L-glutamyl 5-phosphate + ADP. It is also the substrate for the enzyme glutamate-5-semialdehyde dehydrogenase which catalyzes the reaction gamma-L-glutamyl 5-phosphate + NADPH + H+ -> L-glutamate-5-semialdehyde + NADP+ + phosphate (BioCyc compound: L-GLUTAMATE-5-P).
Structure
Synonyms
ValueSource
(2S)-2-Ammonio-5-oxo-5-(phosphonatooxy)pentanoateChEBI
L-gamma-Glutamyl phosphate dianionChEBI
L-Glutamyl 5-phosphateChEBI
(2S)-2-Ammonio-5-oxo-5-(phosphonatooxy)pentanoic acidGenerator
L-g-Glutamyl phosphate dianionGenerator
L-g-Glutamyl phosphoric acid dianionGenerator
L-gamma-Glutamyl phosphoric acid dianionGenerator
L-Γ-glutamyl phosphate dianionGenerator
L-Γ-glutamyl phosphoric acid dianionGenerator
L-Glutamyl 5-phosphoric acidGenerator
Γ-L-glutamyl 5-phosphoric acidGenerator
L-g-Glutamyl phosphate(2-)Generator
L-g-Glutamyl phosphoric acid(2-)Generator
L-gamma-Glutamyl phosphoric acid(2-)Generator
L-γ-glutamyl phosphate(2-)Generator
L-γ-glutamyl phosphoric acid(2-)Generator
Chemical FormulaC5H8NO7P
Average Molecular Weight225.094
Monoisotopic Molecular Weight225.004935759
IUPAC Name(2S)-2-amino-5-(hydrogen phosphonatooxy)-5-oxopentanoate
Traditional Name(2S)-2-amino-5-(hydrogen phosphonatooxy)-5-oxopentanoate
CAS Registry NumberNot Available
SMILES
[H][C@](N)(CCC(=O)OP(O)([O-])=O)C([O-])=O
InChI Identifier
InChI=1S/C5H10NO7P/c6-3(5(8)9)1-2-4(7)13-14(10,11)12/h3H,1-2,6H2,(H,8,9)(H2,10,11,12)/p-2/t3-/m0/s1
InChI KeyPJRXVIJAERNUIP-VKHMYHEASA-L