Showing metabocard for Ethyl methylthiopropanoate (MMDBc0047697)

Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-11-19 15:38:29 UTC
Update Date2022-09-01 01:47:45 UTC
MiMeDB IDMMDBc0047697
Metabolite Identification
Common NameEthyl methylthiopropanoate
DescriptionEthyl 3-(methylthio)propanoate, also known as ethyl methyl mercaptopropionate, belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). Ethyl 3-(methylthio)propanoate is a fruity, metallic, and pineapple tasting compound. Ethyl 3-(methylthio)propanoate is found, on average, in the highest concentration within pineapples (Ananas comosus). Ethyl 3-(methylthio)propanoate has also been detected, but not quantified in, several different foods, such as alcoholic beverages, asian pears (Pyrus pyrifolia), fruits, and milk and milk products. This could make ethyl 3-(methylthio)propanoate a potential biomarker for the consumption of these foods. Ethyl 3-(methylthio)propanoate is a secondary metabolite. Secondary metabolites are metabolically or physiologically non-essential metabolites that may serve a role as defense or signalling molecules. In some cases they are simply molecules that arise from the incomplete metabolism of other secondary metabolites. Based on a literature review a significant number of articles have been published on Ethyl 3-(methylthio)propanoate.
Structure
MOL3D MOLSDF3D SDFPDB3D PDBSMILESInChI

MOL for #<Metabolite:0x00007f0920148f68>


  Mrv0541 05061311492D          

  9  8  0  0  0  0            999 V2000
    1.0461    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0474    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7605    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9039    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6184    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1895    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1895    2.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750    1.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3329    1.4289    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  5  4  1  0  0  0  0
  6  4  1  0  0  0  0
  7  6  2  0  0  0  0
  8  3  1  0  0  0  0
  8  6  1  0  0  0  0
  9  2  1  0  0  0  0
  9  5  1  0  0  0  0
M  END
Download

3D MOL for #<Metabolite:0x00007f0920148f68>

HMDB0040413
     RDKit          3D
Ethyl 3-(methylthio)propanoate
 21 20  0  0  0  0  0  0  0  0999 V2000
   -3.2316    1.0279    0.5774 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6586   -0.2047    1.1374 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3102   -0.4565    0.8839 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7240   -0.6079   -0.3296 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4894   -0.5079   -1.3246 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6961   -0.8736   -0.6048 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3169    0.4331   -1.0555 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0768    0.2283   -1.4264 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0225   -0.1667    0.0712 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4680    1.7225    1.4118 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5750    1.5981   -0.1078 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2194    0.8478    0.0642 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2096   -1.0758    0.6629 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9114   -0.2871    2.2147 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8083   -1.6376   -1.4070 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2562   -1.2498    0.2702 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1435    1.2002   -0.2766 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8183    0.7922   -1.9791 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5512    0.2924    0.9692 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0688    0.1834    0.0215 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0385   -1.2582    0.2269 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  1 10  1  0
  1 11  1  0
  1 12  1  0
  2 13  1  0
  2 14  1  0
  6 15  1  0
  6 16  1  0
  7 17  1  0
  7 18  1  0
  9 19  1  0
  9 20  1  0
  9 21  1  0
M  END
Download

3D SDF for #<Metabolite:0x00007f0920148f68>


  Mrv0541 05061311492D          

  9  8  0  0  0  0            999 V2000
    1.0461    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0474    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7605    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9039    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6184    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1895    1.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1895    2.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750    1.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3329    1.4289    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0  0  0  0
  5  4  1  0  0  0  0
  6  4  1  0  0  0  0
  7  6  2  0  0  0  0
  8  3  1  0  0  0  0
  8  6  1  0  0  0  0
  9  2  1  0  0  0  0
  9  5  1  0  0  0  0
M  END
> <DATABASE_ID>
MMDBc0047697

> <DATABASE_NAME>
MIME

> <SMILES>
CCOC(=O)CCSC

> <INCHI_IDENTIFIER>
InChI=1S/C6H12O2S/c1-3-8-6(7)4-5-9-2/h3-5H2,1-2H3

> <INCHI_KEY>
YSNWHRKJEKWJNY-UHFFFAOYSA-N

> <FORMULA>
C6H12O2S

> <MOLECULAR_WEIGHT>
148.223

> <EXACT_MASS>
148.055800318

> <JCHEM_ACCEPTOR_COUNT>
1

> <JCHEM_AVERAGE_POLARIZABILITY>
16.38137288738547

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
0

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
ethyl 3-(methylsulfanyl)propanoate

> <ALOGPS_LOGP>
1.38

> <JCHEM_LOGP>
1.3374995926666668

> <ALOGPS_LOGS>
-1.45

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
0

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA_STRONGEST_BASIC>
-7.0412154028358716

> <JCHEM_POLAR_SURFACE_AREA>
26.3

> <JCHEM_REFRACTIVITY>
39.242599999999996

> <JCHEM_ROTATABLE_BOND_COUNT>
5

> <JCHEM_RULE_OF_FIVE>
1

> <ALOGPS_SOLUBILITY>
5.30e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
ethyl 3-(methylsulfanyl)propanoate

> <JCHEM_VEBER_RULE>
1

$$$$
Download

3D-SDF for #<Metabolite:0x00007f0920148f68>

HMDB0040413
     RDKit          3D
Ethyl 3-(methylthio)propanoate
 21 20  0  0  0  0  0  0  0  0999 V2000
   -3.2316    1.0279    0.5774 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6586   -0.2047    1.1374 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3102   -0.4565    0.8839 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7240   -0.6079   -0.3296 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4894   -0.5079   -1.3246 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6961   -0.8736   -0.6048 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3169    0.4331   -1.0555 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0768    0.2283   -1.4264 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0225   -0.1667    0.0712 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4680    1.7225    1.4118 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5750    1.5981   -0.1078 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2194    0.8478    0.0642 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2096   -1.0758    0.6629 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9114   -0.2871    2.2147 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8083   -1.6376   -1.4070 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2562   -1.2498    0.2702 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1435    1.2002   -0.2766 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8183    0.7922   -1.9791 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5512    0.2924    0.9692 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0688    0.1834    0.0215 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0385   -1.2582    0.2269 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  1 10  1  0
  1 11  1  0
  1 12  1  0
  2 13  1  0
  2 14  1  0
  6 15  1  0
  6 16  1  0
  7 17  1  0
  7 18  1  0
  9 19  1  0
  9 20  1  0
  9 21  1  0
M  END
Download

PDB for #<Metabolite:0x00007f0920148f68>

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       1.953   2.667   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      11.288   3.437   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       3.286   3.437   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       7.287   2.667   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       8.621   3.437   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       5.954   3.437   0.000  0.00  0.00           C+0
HETATM    7  O   UNK     0       5.954   4.977   0.000  0.00  0.00           O+0
HETATM    8  O   UNK     0       4.620   2.667   0.000  0.00  0.00           O+0
HETATM    9  S   UNK     0       9.955   2.667   0.000  0.00  0.00           S+0
CONECT    1    3                                                            
CONECT    2    9                                                            
CONECT    3    1    8                                                       
CONECT    4    5    6                                                       
CONECT    5    4    9                                                       
CONECT    6    4    7    8                                                  
CONECT    7    6                                                            
CONECT    8    3    6                                                       
CONECT    9    2    5                                                       
MASTER        0    0    0    0    0    0    0    0    9    0   16    0
END
Download

3D PDB for #<Metabolite:0x00007f0920148f68>

COMPND    HMDB0040413
HETATM    1  C1  UNL     1      -3.232   1.028   0.577  1.00  0.00           C  
HETATM    2  C2  UNL     1      -2.659  -0.205   1.137  1.00  0.00           C  
HETATM    3  O1  UNL     1      -1.310  -0.457   0.884  1.00  0.00           O  
HETATM    4  C3  UNL     1      -0.724  -0.608  -0.330  1.00  0.00           C  
HETATM    5  O2  UNL     1      -1.489  -0.508  -1.325  1.00  0.00           O  
HETATM    6  C4  UNL     1       0.696  -0.874  -0.605  1.00  0.00           C  
HETATM    7  C5  UNL     1       1.317   0.433  -1.055  1.00  0.00           C  
HETATM    8  S1  UNL     1       3.077   0.228  -1.426  1.00  0.00           S  
HETATM    9  C6  UNL     1       4.022  -0.167   0.071  1.00  0.00           C  
HETATM   10  H1  UNL     1      -3.468   1.722   1.412  1.00  0.00           H  
HETATM   11  H2  UNL     1      -2.575   1.598  -0.108  1.00  0.00           H  
HETATM   12  H3  UNL     1      -4.219   0.848   0.064  1.00  0.00           H  
HETATM   13  H4  UNL     1      -3.210  -1.076   0.663  1.00  0.00           H  
HETATM   14  H5  UNL     1      -2.911  -0.287   2.215  1.00  0.00           H  
HETATM   15  H6  UNL     1       0.808  -1.638  -1.407  1.00  0.00           H  
HETATM   16  H7  UNL     1       1.256  -1.250   0.270  1.00  0.00           H  
HETATM   17  H8  UNL     1       1.144   1.200  -0.277  1.00  0.00           H  
HETATM   18  H9  UNL     1       0.818   0.792  -1.979  1.00  0.00           H  
HETATM   19  H10 UNL     1       3.551   0.292   0.969  1.00  0.00           H  
HETATM   20  H11 UNL     1       5.069   0.183   0.022  1.00  0.00           H  
HETATM   21  H12 UNL     1       4.039  -1.258   0.227  1.00  0.00           H  
CONECT    1    2   10   11   12
CONECT    2    3   13   14
CONECT    3    4
CONECT    4    5    5    6
CONECT    6    7   15   16
CONECT    7    8   17   18
CONECT    8    9
CONECT    9   19   20   21
END
Download

SMILES for #<Metabolite:0x00007f0920148f68>

CCOC(=O)CCSC
Download

INCHI for #<Metabolite:0x00007f0920148f68>

InChI=1S/C6H12O2S/c1-3-8-6(7)4-5-9-2/h3-5H2,1-2H3
Download
Synonyms
ValueSource
3-(Methylthio)propanoic acid ethyl esterChEBI
Ethyl 3-(methylmercapto)propionateChEBI
Ethyl methyl mercaptopropionateChEBI
3-(Methylthio)propanoate ethyl esterGenerator
Ethyl 3-(methylmercapto)propionic acidGenerator
Ethyl methyl mercaptopropionic acidGenerator
Ethyl 3-(methylthio)propanoic acidGenerator
Ethyl 3-(methylthio)propionateChEBI
Ethyl 3-methylmercaptopropionateChEBI
Ethyl 3-(methylthio)propionic acidGenerator
Ethyl 3-methylmercaptopropionic acidGenerator
3-(methylthio)Propionic acid ethylesterHMDB
Ethyl 3-(methylsulfanyl)propanoateHMDB
Ethyl 3-methylthiopropanoateHMDB
Ethyl beta -methylthiopropionateHMDB
Ethyl beta-methylthiopropionateHMDB
Ethyl methylthiopropanoateHMDB
FEMA 3343HMDB
Propanoic acid, 3-(methylthio)-, ethyl esterHMDB
Propionic acid, 3-(methylthio)-, ethyl esterHMDB
Ethyl 3-(methylthio)propanoateChEBI
Ethyl 3-methylthiopropionic acidGenerator
Chemical FormulaC6H12O2S
Average Molecular Weight148.223
Monoisotopic Molecular Weight148.055800318
IUPAC Nameethyl 3-(methylsulfanyl)propanoate
Traditional Nameethyl 3-(methylsulfanyl)propanoate
CAS Registry NumberNot Available
SMILES
CCOC(=O)CCSC
InChI Identifier
InChI=1S/C6H12O2S/c1-3-8-6(7)4-5-9-2/h3-5H2,1-2H3
InChI KeyYSNWHRKJEKWJNY-UHFFFAOYSA-N