| Description | 1,3,5-Trihydroxybenzene, also known as 1,3,5-benzenetriol or benzene-1,3,5-triol, belongs to the class of organic compounds known as phloroglucinols and derivatives. Phloroglucinols and derivatives are compounds containing a phloroglucinol (benzene-1,3,5-triol) moiety, which consists of a benzene ring bearing one hydroxyl group at positions 1,3, and 5. 1,3,5-Trihydroxybenzene is found, on average, in the highest concentration within garden onions (Allium cepa). 1,3,5-Trihydroxybenzene has also been detected, but not quantified in, several different foods, such as sweet rowanberries (Grataegosorbus mitschurinii), common wheats (Triticum aestivum), nopals (Opuntia cochenillifera), grapefruits (Citrus X paradisi), and climbing beans (Vigna umbellata). This could make 1,3,5-trihydroxybenzene a potential biomarker for the consumption of these foods. 1,3,5-Trihydroxybenzene is a primary metabolite. Primary metabolites are metabolically or physiologically essential metabolites. They are directly involved in an organism’s growth, development or reproduction. Based on a literature review a significant number of articles have been published on 1,3,5-Trihydroxybenzene. |
|---|
| Structure | InChI=1S/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H |
|---|
| Synonyms | | Value | Source |
|---|
| 1,3,5-Benzenetriol | ChEBI | | Benzene-1,3,5-triol | ChEBI | | S-Trihydroxybenzene | ChEBI | | Dilospan S | Kegg | | 1,3,5-Trihydroxybenzene | ChEBI | | 1,3, 5-Trihydroxybenzene | HMDB | | 1,3,5-Benzenetriol (acd/name 4.0) | HMDB | | 1,3,5-Trihydroxy-benzene | HMDB | | 1,3,5-Trihydroxycyclohexatriene | HMDB | | 1,3,5-Triol | HMDB | | 3,5-Dihydroxyphenol | HMDB | | 5-Benzenetriol | HMDB | | 5-Hydroxyresorcinol | HMDB | | 5-Oxyresorcinol | HMDB | | 5-Oxyresorcinolphloroglucin | HMDB | | Benzene, trihydroxy | HMDB | | Benzene-S-triol | HMDB | | Floroglucin | HMDB | | Floroglucinol | HMDB | | Phloroglucin | HMDB | | Phloroglucine | HMDB | | Phloroglucinol (1,3,5-benzenetriol) | HMDB | | Spasfon-lyoc | HMDB, MeSH | | Sym-trihydroxybenzene | HMDB | | Spassirex | MeSH | | Phloroglucinol | HMDB |
|
|---|