Record Information
Version1.0
StatusDetected and Quantified
Creation Date2022-11-09 19:14:31 UTC
Update Date2022-12-15 22:52:22 UTC
MiMeDB IDMMDBc0057144
Metabolite Identification
Common Name2'-Deoxyguanosine 5'-triphosphate
DescriptiondGTP, also known as deoxy-GTP, belongs to the class of organic compounds known as purine 2'-deoxyribonucleoside triphosphates. These are purine nucleotides with triphosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. dGTP is an extremely weak basic (essentially neutral) compound (based on its pKa). dGTP exists in all living species, ranging from bacteria to humans. dGTP can be biosynthesized from dGDP through its interaction with the enzyme nucleoside diphosphate kinase 6. In humans, dGTP is involved in the metabolic disorder called the mitochondrial dna depletion syndrome-3 pathway. Outside of the human body, dGTP has been detected, but not quantified in, several different foods, such as black cabbages, tree ferns, chives, coconuts, and cumins. This could make dGTP a potential biomarker for the consumption of these foods. dGTP is a potentially toxic compound. A purine 2'-deoxyribonucleoside 5'-triphosphate having guanine as the nucleobase.
Structure
Synonyms
ValueSource
2'-Deoxyguanosine 5'-triphosphateChEBI
Deoxyguanosine 5'-triphosphateChEBI
Deoxyguanosine triphosphateChEBI
2'-Deoxyguanosine 5'-triphosphoric acidGenerator
Deoxyguanosine 5'-triphosphoric acidGenerator
Deoxyguanosine triphosphoric acidGenerator
2'-Deoxyguanosine triphosphateHMDB
Deoxy-GTPHMDB
Deoxyguanosine triphosphate, 3H-labeledHMDB
Chemical FormulaC10H16N5O13P3
Average Molecular Weight507.181
Monoisotopic Molecular Weight506.995745159
IUPAC Name({[({[(2R,3S,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid
Traditional NamedGTP
CAS Registry NumberNot Available
SMILES
NC1=NC2=C(N=CN2[C@H]2C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O2)C(=O)N1
InChI Identifier
InChI=1S/C10H16N5O13P3/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1
InChI KeyHAAZLUGHYHWQIW-KVQBGUIXSA-N