| MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
| MMDBr0012899 | Guanosine triphosphate | Carbon dioxide | Phosphoenolpyruvate carboxykinase [GTP] | Carboxykinase | RHEA | 34755880 |
| MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
| MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Dehydratase | RHEA | 34755880 |
| MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013026 | Hydrogen Ion | Carbon dioxide | Orotidine 5'-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
| MMDBr0013038 | diphosphate | Phosphoribosyl pyrophosphate | Tryptophan biosynthesis protein TrpCD | Phosphoribosyltransferase; Synthesis | RHEA | 34755880 |
| MMDBr0013170 | Adenosine monophosphate | ADP | Adenylate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | ATP hydrolysis; Dehydratase; Dephosphorylation; Gyrase; Nucleic acid synthesis and/or repair; Nucleic acid unzipping and/or repair; Primase; Replicase; Terminase | RHEA | 34755880 |
| MMDBr0013187 | Adenosine triphosphate | Shikimate 3-phosphate | Pentafunctional AROM polypeptide | Phosphorylation | RHEA | 34755880 |
| MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
| MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Aminomutase | RHEA | 34755880 |
| MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
| MMDBr0013357 | (2R)-3-phosphoglyceric acid | (2R)-3-phospho-glyceroyl phosphate | Phosphoglycerate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013570 | Water | 2-Aminobenzoic acid | Kynureninase | Kynureninase | RHEA | 34755880 |
| MMDBr0013642 | (S)-2,3,4,5-tetrahydrodipicolinate | (S)-2-succinylamino-6-oxoheptanedioic acid | 2,3,4,5-tetrahydropyridine-2,6-dicarboxylate N-succinyltransferase | Succinyltransferase | RHEA | 34755880 |
| MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
| MMDBr0013755 | D-Ribose-5-phosphate | Water | Pseudouridine-5'-phosphate glycosidase | Glycosidase | RHEA | 34755880 |
| MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013771 | D-Ribulose 5-phosphate | L-3,4-Dihydroxybutan-2-one 4-phosphate | 3,4-dihydroxy-2-butanone 4-phosphate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013848 | dCTP | diphosphate | dCTP deaminase, dUMP-forming | Deamination | RHEA | 34755880 |
| MMDBr0013884 | Hydrogen Ion | beta-Alanine | L-aspartate decarboxylase dtxS4 | Decarboxylation | RHEA | 34755880 |
| MMDBr0013895 | L-Glutamic-gamma-semialdehyde | Hydrogen Ion | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
| MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Adenylyltransferase | RHEA | 34755880 |
| MMDBr0013929 | Hydrogen Ion | Carbon dioxide | Uroporphyrinogen decarboxylase | Decarboxylation | RHEA | 34755880 |
| MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Carbamoyltransferase | RHEA | 34755880 |
| MMDBr0013970 | L-Alanine | D-Alanine | L-alanine/L-glutamate racemase | Racemization | RHEA | 34755880 |
| MMDBr0013978 | Hydrogen peroxide | Water | Bromoperoxidase-catalase | Catalase; Dimerase; Peroxidation; Synthesis | RHEA | 34755880 |
| MMDBr0014001 | Hydrogen Ion | L-3-Hydroxykynurenine | Kynurenine 3-monooxygenase | Oxygenation | RHEA | 34755880 |
| MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014068 | 3-Dehydroquinate | 3-Dehydroshikimic acid | Catabolic 3-dehydroquinase | Dehydratase; Dehydroquinase | RHEA | 34755880 |
| MMDBr0014117 | N-Acetyl-L-glutamate 5-semialdehyde | Hydrogen Ion | Protein ARG5,6, mitochondrial | Reduction | RHEA | 34755880 |
| MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
| MMDBr0014193 | 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate | diphosphate | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
| MMDBr0014227 | (S)-4-hydroxy-2-oxopentanoic acid | Acetaldehyde | 4-hydroxy-2-oxovalerate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
| MMDBr0014229 | 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate | (2S)-2-[5-Amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamido]succinic acid | Phosphoribosylaminoimidazole-succinocarboxamide synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
| MMDBr0014257 | Adenosine triphosphate | Nicotinic acid adenine dinucleotide | Probable nicotinate-nucleotide adenylyltransferase | Adenylyltransferase; Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0014313 | Acetaldehyde | Acetyl-CoA | Acetaldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0014323 | Adenosine triphosphate | ADP | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
| MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
| MMDBr0014365 | 4-Imidazolone-5-propionic acid | Formiminoglutamic acid | Imidazolonepropionase | Imidazolonepropionase; Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Cyclohydrolase; Synthesis | RHEA | 34755880 |
| MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
| MMDBr0014517 | L-3-Hydroxykynurenine | 3-Hydroxyanthranilic acid | Kynureninase | Kynureninase | RHEA | 34755880 |
| MMDBr0014621 | 1D-myo-inositol 2-(L-cysteinylamino)-2-deoxy-alpha-D-glucopyranoside | CoA | Mycothiol acetyltransferase | Acetyltransferase | RHEA | 34755880 |
| MMDBr0014622 | 1D-myo-inositol 2-acetamido-2-deoxy-alpha-D-glucopyranoside | X-14847 | 1D-myo-inositol 2-acetamido-2-deoxy-alpha-D-glucopyranoside deacetylase | Deacetylase | RHEA | 34755880 |
| MMDBr0014623 | 1D-myo-inositol 3-phosphate | 1D-myo-inositol 2-acetamido-2-deoxy-alpha-D-glucopyranoside 3-phosphate | D-inositol 3-phosphate glycosyltransferase | Glycosylation | RHEA | 34755880 |
| MMDBr0014633 | Co-precorrin-5B | Co-precorrin-6A | Cobalt-precorrin-5B C(1)-methyltransferase | Methylation | RHEA | 34755880 |
| MMDBr0014776 | Farnesyl pyrophosphate | diphosphate | Protoheme IX farnesyltransferase, mitochondrial | Farnesyltransferase | RHEA | 34755880 |
| MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transferase | RHEA | 34755880 |
| MMDBr0014899 | Hydrogen Ion | Hydrogen Ion | Na(+)/H(+) antiporter NhaA | | RHEA | 34755880 |
| MMDBr0014900 | Hydrogen Ion | Hydrogen Ion | Na(+)/H(+) antiporter NhaA | | RHEA | 34755880 |
| MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Dehydratase; Isomerization | RHEA | 34755880 |
| MMDBr0015916 | 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (flavodoxin) | Synthesis | RHEA | 34755880 |
| MMDBr0016358 | 2-[(2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate | Carbon dioxide | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
| MMDBr0016359 | 2-(2-Carboxy-4-methylthiazol-5-yl)ethyl phosphate | Carbon dioxide | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
| MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
| MMDBr0016954 | Adenosine triphosphate | Adenosine monophosphate | UDP-N-acetyl-alpha-D-muramoyl-L-alanyl-L-glutamate epimerase | Epimerization | RHEA | 34755880 |
| MMDBr0016956 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoyl-L-alanine--L-glutamate ligase | Ligation | RHEA | 34755880 |
| MMDBr0017345 | Peroxynitrite | Nitrate | Peroxynitrite isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0017346 | Peroxynitrite | Nitrate | Peroxynitrite isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | | RHEA | 34755880 |
| MMDBr0017852 | Adenosine triphosphate | ADP | Glutamate--cysteine ligase EgtA | | RHEA | 34755880 |
| MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | | RHEA | 34755880 |
| MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | | RHEA | 34755880 |
| MMDBr0017897 | Adenosine triphosphate | diphosphate | S-adenosylmethionine synthase | | RHEA | 34755880 |
| MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | | RHEA | 34755880 |
| MMDBr0017922 | X-14847 | 1D-myo-inositol 2-(L-cysteinylamino)-2-deoxy-alpha-D-glucopyranoside | L-cysteine:1D-myo-inositol 2-amino-2-deoxy-alpha-D-glucopyranoside ligase | | RHEA | 34755880 |
| MMDBr0017931 | Chloride ion | 5'-chloro-5'-deoxyadenosine | Adenosyl-chloride synthase | | RHEA | 34755880 |
| MMDBr0017950 | aldehydo-D-ribose 5-phosphate | Hydrogen Ion | Pyridoxal 5'-phosphate synthase subunit PDX1 | | RHEA | 34755880 |
| MMDBr0024360 | Adenosine triphosphate | diphosphate | Valine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024389 | Adenosine triphosphate | diphosphate | Leucine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024401 | L-Serine | Hydrogen Ion | Holo-[acyl-carrier-protein] synthase | | RHEA | 34755880 |
| MMDBr0024415 | (S)-4-Amino-5-oxopentanoate | Hydrogen Ion | Glutamyl-tRNA reductase | | RHEA | 34755880 |
| MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024449 | Adenosine triphosphate | diphosphate | Methionine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024471 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrA | | RHEA | 34755880 |
| MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024483 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | | RHEA | 34755880 |
| MMDBr0024568 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | | RHEA | 34755880 |
| MMDBr0024597 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp/Asn) ligase | | RHEA | 34755880 |
| MMDBr0024644 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrA | | RHEA | 34755880 |
| MMDBr0024650 | Hydrogen Ion | di-mu-Sulfido-diiron(2+) | Ferredoxin--NADP reductase | | RHEA | 34755880 |
| MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | | RHEA | 34755880 |
| MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024750 | Water | Hydrogen Ion | GTP cyclohydrolase-2 | | RHEA | 34755880 |
| MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | | RHEA | 34755880 |
| MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | | RHEA | 34755880 |
| MMDBr0024851 | L-Dihydroorotic acid | orotate | Dihydroorotate dehydrogenase (quinone) | | RHEA | 34755880 |
| MMDBr0024967 | S-Adenosylmethionine | Hydrogen Ion | tRNA (guanine(37)-N1)-methyltransferase Trm5b | | RHEA | 34755880 |
| MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | | RHEA | 34755880 |
| MMDBr0024977 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein S12 methylthiotransferase RimO | | RHEA | 34755880 |
| MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | | RHEA | 34755880 |
| MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | | RHEA | 34755880 |
| MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | | RHEA | 34755880 |
| MMDBr0025167 | Adenosine triphosphate | Hydrogen Ion | tRNA(Ile)-lysidine synthase | | RHEA | 34755880 |
| MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | | RHEA | 34755880 |
| MMDBr0025514 | Acetyl-CoA | Malonyl-CoA | Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha | | RHEA | 34755880 |
| MMDBr0025650 | Hydrogen Ion | Hydrogen Ion | NADH-quinone oxidoreductase subunit C/D | | RHEA | 34755880 |
| MMDBr0026014 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
| MMDBr0026015 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
| MMDBr0026016 | Phosphate | Guanosine 3',5'-bis(diphosphate) | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
| MMDBr0026017 | Phosphate | Adenosine diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
| MMDBr0026065 | Cytidine triphosphate | Cytidine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026066 | Uridine triphosphate | Uridine 5'-monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026067 | Adenosine triphosphate | Adenosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026068 | Guanosine triphosphate | Guanosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026089 | Deoxyuridine triphosphate | 2'-Deoxyuridine 5'-phosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026090 | Deoxycytidine 5'-triphosphate | 2'-Deoxycytidine 5'-phosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026091 | Deoxyadenosine triphosphate | Deoxyadenosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026092 | 2'-Deoxyguanosine 5'-triphosphate | 2'-Deoxyguanosine 5'-monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |