MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
MMDBr0012876 | Deoxyuridine triphosphate | diphosphate | Probable deoxyuridine 5'-triphosphate nucleotidohydrolase | Dephosphorylation; Nucleotidohydrolase | RHEA | 34755880 |
MMDBr0012889 | Pyroglutamic acid | ADP | 5-oxoprolinase | oxoprolinase | RHEA | 34755880 |
MMDBr0012895 | diphosphate | Phosphoribosyl pyrophosphate | Orotate phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0012943 | diphosphate | Phosphoribosyl pyrophosphate | Xanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0012954 | Adenosine triphosphate | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Dehydratase | RHEA | 34755880 |
MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0013001 | Acetic acid | Acetyl phosphate | Acetate kinase | Formyltransferase; Phosphorylation | RHEA | 34755880 |
MMDBr0013002 | Acetic acid | Acetyl phosphate | Probable acetate kinase EutP | Phosphorylation | RHEA | 34755880 |
MMDBr0013003 | Acetyl phosphate | Acetic acid | Probable acetate kinase EutP | Phosphorylation | RHEA | 34755880 |
MMDBr0013027 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013045 | Alpha-D-glucose 6-phosphate | beta-D-Fructose 6-phosphate | Glucose-6-phosphate isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Hydroxymethyltransferase | RHEA | 34755880 |
MMDBr0013083 | Glucose 1-phosphate | ADP-alpha-D-glucose | Glucose-1-phosphate adenylyltransferase | Adenylyltransferase | RHEA | 34755880 |
MMDBr0013088 | Glucosamine 6-phosphate | beta-D-Fructose 6-phosphate | D-galactosamine-6-phosphate deaminase AgaS | Deamination; Isomerization | RHEA | 34755880 |
MMDBr0013098 | NADP(+) | Hydrogen Ion | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
MMDBr0013134 | D-Glyceraldehyde 3-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose-5-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013143 | Putrescine | Hydrogen Ion | Polyamine aminopropyltransferase | Aminopropyltransferase; Synthesis; Transferase | RHEA | 34755880 |
MMDBr0013170 | Adenosine monophosphate | ADP | Adenylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013173 | diphosphate | Phosphoribosyl pyrophosphate | Bifunctional protein PyrR | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | ATP hydrolysis; Dehydratase; Dephosphorylation; Gyrase; Nucleic acid synthesis and/or repair; Nucleic acid unzipping and/or repair; Primase; Replicase; Terminase | RHEA | 34755880 |
MMDBr0013184 | (S)-2,3,4,5-tetrahydrodipicolinate | CoA | 2,3,4,5-tetrahydropyridine-2,6-dicarboxylate N-acetyltransferase | Acetyltransferase | RHEA | 34755880 |
MMDBr0013194 | Water | Hydroxymethylbilane | Porphobilinogen deaminase | Deamination | RHEA | 34755880 |
MMDBr0013201 | Guanosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Phosphorylation | RHEA | 34755880 |
MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Cytidylyltransferase | RHEA | 34755880 |
MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
MMDBr0013224 | Hydrogen Ion | diphosphate | Bifunctional protein GlmU | Acetyltransferase; Pyrophosphorylase | RHEA | 34755880 |
MMDBr0013225 | L-Dihydroorotic acid | Hydrogen Ion | Dihydroorotate dehydrogenase B (NAD(+)), catalytic subunit | Dehydrogenation | RHEA | 34755880 |
MMDBr0013246 | 2-C-methyl-D-erythritol 4-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose 5-phosphate reductoisomerase | Reductoisomerase | RHEA | 34755880 |
MMDBr0013248 | Acetyl-CoA | CoA | Bifunctional protein GlmU | Acetyltransferase | RHEA | 34755880 |
MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
MMDBr0013357 | (2R)-3-phosphoglyceric acid | (2R)-3-phospho-glyceroyl phosphate | Phosphoglycerate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013413 | Ethanolamine | Acetaldehyde | Ethanolamine ammonia-lyase large subunit | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013488 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0013489 | adenosylcob(III)inamide-GDP | coenzyme B12 | Adenosylcobinamide-GDP ribazoletransferase | Ribazoletransferase | RHEA | 34755880 |
MMDBr0013495 | Adenosine triphosphate | ADP | ATP-dependent 6-phosphofructokinase | Phosphofructokinase | RHEA | 34755880 |
MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
MMDBr0013529 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoylalanine--D-glutamate ligase | Ligation | RHEA | 34755880 |
MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0013605 | Ciliatine | L-Alanine | 2-aminoethylphosphonate--pyruvate transaminase | Hydrolysis of bond; Transaminase | RHEA | 34755880 |
MMDBr0013611 | D-Glyceraldehyde 3-phosphate | beta-D-Fructose 6-phosphate | Transaldolase | Transfer of aldol group | RHEA | 34755880 |
MMDBr0013659 | Guanosine triphosphate | 7,8-dihydroneopterin 3'-triphosphate | Bifunctional protein FolKE | Cyclohydrolase | RHEA | 34755880 |
MMDBr0013683 | S-Ribosyl-L-homocysteine | (4S)-4,5-Dihydroxypentan-2,3-dione | S-ribosylhomocysteine lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0013703 | Dihydroxyacetone phosphate | BPG | Methylglyoxal synthase | Synthesis | RHEA | 34755880 |
MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013770 | Water | Phosphoribosyl formamidocarboxamide | Bifunctional purine biosynthesis protein PurH | Cyclohydrolase | RHEA | 34755880 |
MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0013805 | Adenosine triphosphate | Adenosine monophosphate | Selenide, water dikinase | Dikinase | RHEA | 34755880 |
MMDBr0013809 | Ribose-1-phosphate | D-Ribose-5-phosphate | Phosphopentomutase | Phosphopentomutase; Phosphoribomutase | RHEA | 34755880 |
MMDBr0013820 | Water | Acetaldehyde | Phosphonoacetaldehyde hydrolase | Hydrolysis of bond | RHEA | 34755880 |
MMDBr0013908 | Guanosine triphosphate | Guanosine diphosphate | GTPase ArgK | Dephosphorylation; GTP hydrolysis; Intramolecular transfer of functional group; Nucleic acid synthesis and/or repair; Phytase | RHEA | 34755880 |
MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Carbamoyltransferase | RHEA | 34755880 |
MMDBr0013966 | (6S)-5,6,7,8-tetrahydrofolic acid | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Ligation; Synthesis | RHEA | 34755880 |
MMDBr0014035 | Adenosine triphosphate | ADP | Guanylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014062 | Acetyl-CoA | Acetoacetyl-CoA | Acetyl-CoA acetyltransferase | Acetyltransferase; Acylation; Ketothiolase | RHEA | 34755880 |
MMDBr0014068 | 3-Dehydroquinate | 3-Dehydroshikimic acid | Catabolic 3-dehydroquinase | Dehydratase; Dehydroquinase | RHEA | 34755880 |
MMDBr0014083 | Shikimate 3-phosphate | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Pentafunctional AROM polypeptide | Carboxyvinyltransferase | RHEA | 34755880 |
MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
MMDBr0014180 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional purine biosynthesis protein PurH | | RHEA | 34755880 |
MMDBr0014193 | 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate | diphosphate | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
MMDBr0014240 | p-Hydroxyphenylacetic acid | p-Cresol | 4-hydroxyphenylacetate decarboxylase glycyl radical subunit | Decarboxylation | RHEA | 34755880 |
MMDBr0014241 | p-Hydroxyphenylacetic acid | p-Cresol | 4-hydroxyphenylacetate decarboxylase glycyl radical subunit | Decarboxylation | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014323 | Adenosine triphosphate | ADP | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0014353 | adenosylcob(III)inamide-GDP | adenosylcob(III)alamin 5'-phosphate | Adenosylcobinamide-GDP ribazoletransferase | Ribazoletransferase | RHEA | 34755880 |
MMDBr0014366 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase | Ligation | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Cyclohydrolase; Synthesis | RHEA | 34755880 |
MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014426 | 4-Methyl-5-(2-hydroxyethyl)-thiazole | 4-methyl-5-(2-phosphooxyethyl)-thiazole | Probable thiamine biosynthetic bifunctional enzyme | Phosphorylation | RHEA | 34755880 |
MMDBr0014437 | L-Dihydroorotic acid | Hydrogen Ion | Dihydroorotase | Dihydroorotase | RHEA | 34755880 |
MMDBr0014444 | Phosphate | Ribose-1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0014447 | Adenosine triphosphate | ADP | UMP-CMP kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014454 | Adenosine triphosphate | ADP | Phosphate-import ATP-binding protein PhnC | | RHEA | 34755880 |
MMDBr0014502 | 1,6-Anhydro-N-acetyl-beta-muramate | ADP | Anhydro-N-acetylmuramic acid kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014514 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014596 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014597 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014633 | Co-precorrin-5B | Co-precorrin-6A | Cobalt-precorrin-5B C(1)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0014642 | Water | D-Lactic acid | N-acetylmuramic acid 6-phosphate etherase | Etherase | RHEA | 34755880 |
MMDBr0014707 | Phosphate | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0014708 | Deoxyadenosine | Adenine | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014710 | Inosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
MMDBr0014768 | Phosphate | CoA | Phosphate propanoyltransferase | Acetyltransferase; Propanoyltransferase | RHEA | 34755880 |
MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation; Phosphatidylglycerophosphatase | RHEA | 34755880 |
MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transferase | RHEA | 34755880 |
MMDBr0014846 | Thymidine 5'-triphosphate | diphosphate | dTTP/UTP pyrophosphatase | Dephosphorylation; Pyrophosphatase | RHEA | 34755880 |
MMDBr0014908 | Water | diphosphate | dTTP/UTP pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
MMDBr0014935 | Adenosine triphosphate | ADP | Methionine import ATP-binding protein MetN | | RHEA | 34755880 |
MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Dehydratase; Isomerization | RHEA | 34755880 |
MMDBr0015324 | L-Glutamic acid | 3-aminopentanedioic acid | Glutamate 2,3-aminomutase | Aminomutase | RHEA | 34755880 |
MMDBr0015425 | Adenosine triphosphate | 3',3'-c-di-AMP | Cyclic di-AMP synthase CdaA | Cycle formation; Synthesis | RHEA | 34755880 |
MMDBr0016358 | 2-[(2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate | Carbon dioxide | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
MMDBr0016359 | 2-(2-Carboxy-4-methylthiazol-5-yl)ethyl phosphate | Carbon dioxide | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
MMDBr0016600 | Cytidine | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0017243 | 3,4-Dihydroxybenzeneacetic acid | 4-Methylcatechol | 4-hydroxyphenylacetate decarboxylase glycyl radical subunit | Decarboxylation | RHEA | 34755880 |
MMDBr0017244 | 3,4-Dihydroxybenzeneacetic acid | 4-Methylcatechol | 4-hydroxyphenylacetate decarboxylase glycyl radical subunit | Decarboxylation | RHEA | 34755880 |
MMDBr0017835 | L-Proline | D-Proline | Proline racemase | | RHEA | 34755880 |
MMDBr0017843 | Adenosine triphosphate | Adenosine monophosphate | GMP synthase [glutamine-hydrolyzing] | | RHEA | 34755880 |
MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | | RHEA | 34755880 |
MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | | RHEA | 34755880 |
MMDBr0017897 | Adenosine triphosphate | diphosphate | S-adenosylmethionine synthase | | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | | RHEA | 34755880 |
MMDBr0017917 | 5-Aminoimidazole ribonucleotide | 4-Amino-2-methyl-5-phosphomethylpyrimidine | Phosphomethylpyrimidine synthase | | RHEA | 34755880 |
MMDBr0017943 | Adenosine triphosphate | ADP | Methionine import ATP-binding protein MetN | | RHEA | 34755880 |
MMDBr0024389 | Adenosine triphosphate | diphosphate | Leucine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024403 | Hydrogen Ion | Carbon dioxide | 3-oxoacyl-[acyl-carrier-protein] synthase 3 | | RHEA | 34755880 |
MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024435 | Deoxyribose 5-phosphate | Acetaldehyde | Deoxyribose-phosphate aldolase | | RHEA | 34755880 |
MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | | RHEA | 34755880 |
MMDBr0024522 | Adenosine triphosphate | diphosphate | Glycine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024559 | Adenosine triphosphate | Hydrogen Ion | Histidine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024593 | ADP-alpha-D-glucose | Hydrogen Ion | Probable glycogen synthase | | RHEA | 34755880 |
MMDBr0024630 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase A | | RHEA | 34755880 |
MMDBr0024636 | Phosphate | Ribose-1-phosphate | Probable 6-oxopurine nucleoside phosphorylase | | RHEA | 34755880 |
MMDBr0024649 | Adenosine triphosphate | diphosphate | Glutamine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024656 | Adenosine triphosphate | diphosphate | Arginine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | | RHEA | 34755880 |
MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | | RHEA | 34755880 |
MMDBr0024770 | Hydrogen Ion | L-Cysteine | Probable tRNA sulfurtransferase | | RHEA | 34755880 |
MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | | RHEA | 34755880 |
MMDBr0024782 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | | RHEA | 34755880 |
MMDBr0024787 | Adenosine triphosphate | Hydrogen Ion | Threonine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024789 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | | RHEA | 34755880 |
MMDBr0024808 | 1-Deoxy-D-xylulose 5-phosphate | Water | Thiazole synthase | | RHEA | 34755880 |
MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | | RHEA | 34755880 |
MMDBr0024826 | 2-deoxy-alpha-D-ribose 1-phosphate | Deoxyribose 5-phosphate | Phosphopentomutase | | RHEA | 34755880 |
MMDBr0024883 | S-Adenosylmethionine | Hydrogen Ion | S-adenosylmethionine:tRNA ribosyltransferase-isomerase | | RHEA | 34755880 |
MMDBr0024925 | Glycerol 3-phosphate | Phosphate | Glycerol-3-phosphate acyltransferase | | RHEA | 34755880 |
MMDBr0024967 | S-Adenosylmethionine | Hydrogen Ion | tRNA (guanine(37)-N1)-methyltransferase Trm5b | | RHEA | 34755880 |
MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | | RHEA | 34755880 |
MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | | RHEA | 34755880 |
MMDBr0024977 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein S12 methylthiotransferase RimO | | RHEA | 34755880 |
MMDBr0025071 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (guanine-N(7)-)-methyltransferase | | RHEA | 34755880 |
MMDBr0025085 | S-Adenosylmethionine | Hydrogen Ion | Putative ribosomal RNA large subunit methyltransferase H | | RHEA | 34755880 |
MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | | RHEA | 34755880 |
MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | | RHEA | 34755880 |
MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | | RHEA | 34755880 |
MMDBr0025163 | ADP | Hydrogen Ion | Putative pyruvate, phosphate dikinase regulatory protein 1 | | RHEA | 34755880 |
MMDBr0025164 | Hydrogen Ion | diphosphate | Putative pyruvate, phosphate dikinase regulatory protein 1 | | RHEA | 34755880 |
MMDBr0025167 | Adenosine triphosphate | Hydrogen Ion | tRNA(Ile)-lysidine synthase | | RHEA | 34755880 |
MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | | RHEA | 34755880 |
MMDBr0025514 | Acetyl-CoA | Malonyl-CoA | Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha | | RHEA | 34755880 |
MMDBr0025620 | L-Cysteine | Hydrogen Ion | Phosphatidylglycerol--prolipoprotein diacylglyceryl transferase | | RHEA | 34755880 |
MMDBr0025656 | Acetic acid | diphosphate | tRNA(Met) cytidine acetate ligase | | RHEA | 34755880 |
MMDBr0025766 | Glycine | Hydrogen Ion | Putative glycyl-radical enzyme activating enzyme MJ1227 | | RHEA | 34755880 |