| MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
| MMDBr0012876 | Deoxyuridine triphosphate | diphosphate | Probable deoxyuridine 5'-triphosphate nucleotidohydrolase | Dephosphorylation; Nucleotidohydrolase | RHEA | 34755880 |
| MMDBr0012889 | Pyroglutamic acid | ADP | 5-oxoprolinase | oxoprolinase | RHEA | 34755880 |
| MMDBr0012943 | diphosphate | Phosphoribosyl pyrophosphate | Xanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012954 | Adenosine triphosphate | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Dehydratase | RHEA | 34755880 |
| MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
| MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013001 | Acetic acid | Acetyl phosphate | Acetate kinase | Formyltransferase; Phosphorylation | RHEA | 34755880 |
| MMDBr0013027 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013038 | diphosphate | Phosphoribosyl pyrophosphate | Tryptophan biosynthesis protein TrpCD | Phosphoribosyltransferase; Synthesis | RHEA | 34755880 |
| MMDBr0013045 | Alpha-D-glucose 6-phosphate | beta-D-Fructose 6-phosphate | Glucose-6-phosphate isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Hydroxymethyltransferase | RHEA | 34755880 |
| MMDBr0013062 | (6R)-6-(l-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4a-hydroxypterin | 4a-Carbinolamine tetrahydrobiopterin | Putative pterin-4-alpha-carbinolamine dehydratase | Dehydratase | RHEA | 34755880 |
| MMDBr0013088 | Glucosamine 6-phosphate | beta-D-Fructose 6-phosphate | D-galactosamine-6-phosphate deaminase AgaS | Deamination; Isomerization | RHEA | 34755880 |
| MMDBr0013098 | NADP(+) | Hydrogen Ion | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
| MMDBr0013143 | Putrescine | Hydrogen Ion | Polyamine aminopropyltransferase | Aminopropyltransferase; Synthesis; Transferase | RHEA | 34755880 |
| MMDBr0013173 | diphosphate | Phosphoribosyl pyrophosphate | Bifunctional protein PyrR | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | ATP hydrolysis; Dehydratase; Dephosphorylation; Gyrase; Nucleic acid synthesis and/or repair; Nucleic acid unzipping and/or repair; Primase; Replicase; Terminase | RHEA | 34755880 |
| MMDBr0013184 | (S)-2,3,4,5-tetrahydrodipicolinate | CoA | 2,3,4,5-tetrahydropyridine-2,6-dicarboxylate N-acetyltransferase | Acetyltransferase | RHEA | 34755880 |
| MMDBr0013194 | Water | Hydroxymethylbilane | Porphobilinogen deaminase | Deamination | RHEA | 34755880 |
| MMDBr0013212 | 7-Aminomethyl-7-carbaguanine | 7-Cyano-7-carbaguanine | NADPH-dependent 7-cyano-7-deazaguanine reductase | Reduction | RHEA | 34755880 |
| MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Cytidylyltransferase | RHEA | 34755880 |
| MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
| MMDBr0013224 | Hydrogen Ion | diphosphate | Bifunctional protein GlmU | Acetyltransferase; Pyrophosphorylase | RHEA | 34755880 |
| MMDBr0013225 | L-Dihydroorotic acid | Hydrogen Ion | Dihydroorotate dehydrogenase B (NAD(+)), catalytic subunit | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013248 | Acetyl-CoA | CoA | Bifunctional protein GlmU | Acetyltransferase | RHEA | 34755880 |
| MMDBr0013274 | Adenosine triphosphate | ADP | Homoserine kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Aminomutase | RHEA | 34755880 |
| MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
| MMDBr0013370 | Adenosine triphosphate | ADP | Glutamate 5-kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013422 | LL-2,6-Diaminoheptanedioate | Meso-2,6-Diaminoheptanedioate | Diaminopimelate epimerase | Epimerization; Racemization | RHEA | 34755880 |
| MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
| MMDBr0013478 | Hydrogen Ion | Carbon dioxide | S-adenosylmethionine decarboxylase proenzyme | Decarboxylation | RHEA | 34755880 |
| MMDBr0013489 | adenosylcob(III)inamide-GDP | coenzyme B12 | Adenosylcobinamide-GDP ribazoletransferase | Ribazoletransferase | RHEA | 34755880 |
| MMDBr0013495 | Adenosine triphosphate | ADP | ATP-dependent 6-phosphofructokinase | Phosphofructokinase | RHEA | 34755880 |
| MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
| MMDBr0013529 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoylalanine--D-glutamate ligase | Ligation | RHEA | 34755880 |
| MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013571 | Adenosine triphosphate | ADP | Putative uridine kinase DAS2 | Phosphorylation | RHEA | 34755880 |
| MMDBr0013611 | D-Glyceraldehyde 3-phosphate | beta-D-Fructose 6-phosphate | Transaldolase | Transfer of aldol group | RHEA | 34755880 |
| MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
| MMDBr0013681 | NADP(+) | 3-Dehydroshikimic acid | Pentafunctional AROM polypeptide | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013703 | Dihydroxyacetone phosphate | BPG | Methylglyoxal synthase | Synthesis | RHEA | 34755880 |
| MMDBr0013755 | D-Ribose-5-phosphate | Water | Pseudouridine-5'-phosphate glycosidase | Glycosidase | RHEA | 34755880 |
| MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013770 | Water | Phosphoribosyl formamidocarboxamide | Bifunctional purine biosynthesis protein PurH | Cyclohydrolase | RHEA | 34755880 |
| MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013784 | D-Glyceraldehyde 3-phosphate | Dihydroxyacetone phosphate | Bifunctional PGK/TIM | Isomerization | RHEA | 34755880 |
| MMDBr0013809 | Ribose-1-phosphate | D-Ribose-5-phosphate | Phosphopentomutase | Phosphopentomutase; Phosphoribomutase | RHEA | 34755880 |
| MMDBr0013886 | Carbamoylphosphate | Hydrogen Ion | Ornithine carbamoyltransferase | Carbamoyltransferase; Transcarbamylase | RHEA | 34755880 |
| MMDBr0013895 | L-Glutamic-gamma-semialdehyde | Hydrogen Ion | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
| MMDBr0013908 | Guanosine triphosphate | Guanosine diphosphate | GTPase ArgK | Dephosphorylation; GTP hydrolysis; Intramolecular transfer of functional group; Nucleic acid synthesis and/or repair; Phytase | RHEA | 34755880 |
| MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Adenylyltransferase | RHEA | 34755880 |
| MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Carbamoyltransferase | RHEA | 34755880 |
| MMDBr0013978 | Hydrogen peroxide | Water | Bromoperoxidase-catalase | Catalase; Dimerase; Peroxidation; Synthesis | RHEA | 34755880 |
| MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014080 | Adenosine triphosphate | Adenosine monophosphate | NH(3)-dependent NAD(+) synthetase | Synthesis | RHEA | 34755880 |
| MMDBr0014083 | Shikimate 3-phosphate | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Pentafunctional AROM polypeptide | Carboxyvinyltransferase | RHEA | 34755880 |
| MMDBr0014117 | N-Acetyl-L-glutamate 5-semialdehyde | Hydrogen Ion | Protein ARG5,6, mitochondrial | Reduction | RHEA | 34755880 |
| MMDBr0014126 | Adenosine triphosphate | ADP | Glycerol kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014160 | 3-deoxy-D-arabino-heptulosonate-7-phosphate | 3-Dehydroquinate | Pentafunctional AROM polypeptide | Phosphorylation; Synthesis | RHEA | 34755880 |
| MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
| MMDBr0014180 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional purine biosynthesis protein PurH | | RHEA | 34755880 |
| MMDBr0014193 | 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate | diphosphate | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
| MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
| MMDBr0014282 | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | 5-Aminoimidazole ribonucleotide | Bifunctional purine biosynthetic protein ADE5,7 | Ligation | RHEA | 34755880 |
| MMDBr0014323 | Adenosine triphosphate | ADP | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
| MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
| MMDBr0014340 | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | Indole-3-glycerol phosphate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014353 | adenosylcob(III)inamide-GDP | adenosylcob(III)alamin 5'-phosphate | Adenosylcobinamide-GDP ribazoletransferase | Ribazoletransferase | RHEA | 34755880 |
| MMDBr0014365 | 4-Imidazolone-5-propionic acid | Formiminoglutamic acid | Imidazolonepropionase | Imidazolonepropionase; Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0014366 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase | Ligation | RHEA | 34755880 |
| MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Cyclohydrolase; Synthesis | RHEA | 34755880 |
| MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
| MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0014426 | 4-Methyl-5-(2-hydroxyethyl)-thiazole | 4-methyl-5-(2-phosphooxyethyl)-thiazole | Probable thiamine biosynthetic bifunctional enzyme | Phosphorylation | RHEA | 34755880 |
| MMDBr0014447 | Adenosine triphosphate | ADP | UMP-CMP kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014472 | Adenosine triphosphate | ADP | Cytidine kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014514 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014596 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014597 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014619 | L-3,4-Dihydroxybutan-2-one 4-phosphate | 6,7-Dimethyl-8-(1-D-ribityl)lumazine | 6,7-dimethyl-8-ribityllumazine synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014633 | Co-precorrin-5B | Co-precorrin-6A | Cobalt-precorrin-5B C(1)-methyltransferase | Methylation | RHEA | 34755880 |
| MMDBr0014642 | Water | D-Lactic acid | N-acetylmuramic acid 6-phosphate etherase | Etherase | RHEA | 34755880 |
| MMDBr0014768 | Phosphate | CoA | Phosphate propanoyltransferase | Acetyltransferase; Propanoyltransferase | RHEA | 34755880 |
| MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation; Phosphatidylglycerophosphatase | RHEA | 34755880 |
| MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transferase | RHEA | 34755880 |
| MMDBr0014846 | Thymidine 5'-triphosphate | diphosphate | dTTP/UTP pyrophosphatase | Dephosphorylation; Pyrophosphatase | RHEA | 34755880 |
| MMDBr0014908 | Water | diphosphate | dTTP/UTP pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
| MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
| MMDBr0015402 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
| MMDBr0015405 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
| MMDBr0016358 | 2-[(2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate | Carbon dioxide | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
| MMDBr0016359 | 2-(2-Carboxy-4-methylthiazol-5-yl)ethyl phosphate | Carbon dioxide | Probable thiamine biosynthetic bifunctional enzyme | Synthesis | RHEA | 34755880 |
| MMDBr0016758 | Ni(II)-pyridinium-3,5-bisthiocarboxylic acid mononucleotide | Nickel | Pyridinium-3,5-bisthiocarboxylic acid mononucleotide nickel insertion protein | | RHEA | 34755880 |
| MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
| MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | | RHEA | 34755880 |
| MMDBr0017843 | Adenosine triphosphate | Adenosine monophosphate | GMP synthase [glutamine-hydrolyzing] | | RHEA | 34755880 |
| MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | | RHEA | 34755880 |
| MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | | RHEA | 34755880 |
| MMDBr0017879 | Adenosine triphosphate | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | Phosphoribosylformylglycinamidine synthase | | RHEA | 34755880 |
| MMDBr0017903 | L-Histidine | Ammonium | Histidine ammonia-lyase | | RHEA | 34755880 |
| MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | | RHEA | 34755880 |
| MMDBr0017917 | 5-Aminoimidazole ribonucleotide | 4-Amino-2-methyl-5-phosphomethylpyrimidine | Phosphomethylpyrimidine synthase | | RHEA | 34755880 |
| MMDBr0024371 | Adenosine triphosphate | Hydrogen Ion | Asparagine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024389 | Adenosine triphosphate | diphosphate | Leucine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024397 | Water | Hydrogen Ion | Glycine/sarcosine/betaine reductase complex component A | | RHEA | 34755880 |
| MMDBr0024401 | L-Serine | Hydrogen Ion | Holo-[acyl-carrier-protein] synthase | | RHEA | 34755880 |
| MMDBr0024410 | Water | Hydrogen Ion | Glycine/sarcosine/betaine reductase complex component A | | RHEA | 34755880 |
| MMDBr0024411 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024415 | (S)-4-Amino-5-oxopentanoate | Hydrogen Ion | Glutamyl-tRNA reductase | | RHEA | 34755880 |
| MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024436 | Water | Hydrogen Ion | Glycine/sarcosine/betaine reductase complex component A | | RHEA | 34755880 |
| MMDBr0024471 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrA | | RHEA | 34755880 |
| MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024522 | Adenosine triphosphate | diphosphate | Glycine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024539 | Hydrogen Ion | 5'-Deoxyadenosine | Lipoyl synthase | | RHEA | 34755880 |
| MMDBr0024548 | (6S)-5,6,7,8-tetrahydrofolic acid | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | Probable aminomethyltransferase | | RHEA | 34755880 |
| MMDBr0024568 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | | RHEA | 34755880 |
| MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024593 | ADP-alpha-D-glucose | Hydrogen Ion | Probable glycogen synthase | | RHEA | 34755880 |
| MMDBr0024628 | Adenosine triphosphate | Hydrogen Ion | Phenylalanine--tRNA ligase beta subunit | | RHEA | 34755880 |
| MMDBr0024630 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase A | | RHEA | 34755880 |
| MMDBr0024636 | Phosphate | Ribose-1-phosphate | Probable 6-oxopurine nucleoside phosphorylase | | RHEA | 34755880 |
| MMDBr0024644 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrA | | RHEA | 34755880 |
| MMDBr0024656 | Adenosine triphosphate | diphosphate | Arginine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024686 | Water | Hydrogen Ion | Nitrogenase iron protein | | RHEA | 34755880 |
| MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | | RHEA | 34755880 |
| MMDBr0024721 | Hydrogen Ion | Phosphate | L-seryl-tRNA(Sec) selenium transferase | | RHEA | 34755880 |
| MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024770 | Hydrogen Ion | L-Cysteine | Probable tRNA sulfurtransferase | | RHEA | 34755880 |
| MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | | RHEA | 34755880 |
| MMDBr0024779 | Water | formate | Peptide deformylase 1 | | RHEA | 34755880 |
| MMDBr0024782 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | | RHEA | 34755880 |
| MMDBr0024789 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | | RHEA | 34755880 |
| MMDBr0024808 | 1-Deoxy-D-xylulose 5-phosphate | Water | Thiazole synthase | | RHEA | 34755880 |
| MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | | RHEA | 34755880 |
| MMDBr0024826 | 2-deoxy-alpha-D-ribose 1-phosphate | Deoxyribose 5-phosphate | Phosphopentomutase | | RHEA | 34755880 |
| MMDBr0024883 | S-Adenosylmethionine | Hydrogen Ion | S-adenosylmethionine:tRNA ribosyltransferase-isomerase | | RHEA | 34755880 |
| MMDBr0024925 | Glycerol 3-phosphate | Phosphate | Glycerol-3-phosphate acyltransferase | | RHEA | 34755880 |
| MMDBr0024957 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Purine nucleoside phosphorylase | | RHEA | 34755880 |
| MMDBr0024967 | S-Adenosylmethionine | Hydrogen Ion | tRNA (guanine(37)-N1)-methyltransferase Trm5b | | RHEA | 34755880 |
| MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | | RHEA | 34755880 |
| MMDBr0024977 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein S12 methylthiotransferase RimO | | RHEA | 34755880 |
| MMDBr0025050 | Hydrogen Ion | Carbon dioxide | Putative 8-amino-7-oxononanoate synthase | | RHEA | 34755880 |
| MMDBr0025060 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0025071 | S-Adenosylmethionine | S-Adenosylhomocysteine | tRNA (guanine-N(7)-)-methyltransferase | | RHEA | 34755880 |
| MMDBr0025085 | S-Adenosylmethionine | Hydrogen Ion | Putative ribosomal RNA large subunit methyltransferase H | | RHEA | 34755880 |
| MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | | RHEA | 34755880 |
| MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | | RHEA | 34755880 |
| MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | | RHEA | 34755880 |
| MMDBr0025163 | ADP | Hydrogen Ion | Putative pyruvate, phosphate dikinase regulatory protein 1 | | RHEA | 34755880 |
| MMDBr0025164 | Hydrogen Ion | diphosphate | Putative pyruvate, phosphate dikinase regulatory protein 1 | | RHEA | 34755880 |
| MMDBr0025235 | L-Serine | Hydrogen Ion | HPr kinase/phosphorylase | | RHEA | 34755880 |
| MMDBr0025236 | Hydrogen Ion | L-Serine | HPr kinase/phosphorylase | | RHEA | 34755880 |
| MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | | RHEA | 34755880 |
| MMDBr0025326 | Guanosine triphosphate | Hydrogen Ion | Probable GTP 3',8-cyclase | | RHEA | 34755880 |
| MMDBr0025490 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein L11 methyltransferase | | RHEA | 34755880 |
| MMDBr0025493 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase MntA | | RHEA | 34755880 |
| MMDBr0025494 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025495 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025496 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025654 | L-Serine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025655 | L-Serine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025656 | Acetic acid | diphosphate | tRNA(Met) cytidine acetate ligase | | RHEA | 34755880 |
| MMDBr0026022 | Adenosine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026023 | Cytidine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026024 | Uridine 5'-monophosphate | Uridine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026025 | Guanosine monophosphate | Guanosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |