MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
MMDBr0012876 | Deoxyuridine triphosphate | diphosphate | Probable deoxyuridine 5'-triphosphate nucleotidohydrolase | Dephosphorylation; Nucleotidohydrolase | RHEA | 34755880 |
MMDBr0012895 | diphosphate | Phosphoribosyl pyrophosphate | Orotate phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0012954 | Adenosine triphosphate | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Dehydratase | RHEA | 34755880 |
MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
MMDBr0012975 | NAD | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(+)] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012976 | NADP(+) | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(P)+] | Dehydrogenation | RHEA | 34755880 |
MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0012989 | Adenosine triphosphate | ADP | D-alanine--D-alanine ligase | Ligation | RHEA | 34755880 |
MMDBr0013026 | Hydrogen Ion | Carbon dioxide | Orotidine 5'-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013038 | diphosphate | Phosphoribosyl pyrophosphate | Tryptophan biosynthesis protein TrpCD | Phosphoribosyltransferase; Synthesis | RHEA | 34755880 |
MMDBr0013062 | (6R)-6-(l-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4a-hydroxypterin | 4a-Carbinolamine tetrahydrobiopterin | Putative pterin-4-alpha-carbinolamine dehydratase | Dehydratase | RHEA | 34755880 |
MMDBr0013081 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 7,8-dihydrofolate monoglutamate | Bifunctional dihydrofolate reductase-thymidylate synthase | Reduction; Synthesis | RHEA | 34755880 |
MMDBr0013098 | NADP(+) | Hydrogen Ion | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
MMDBr0013134 | D-Glyceraldehyde 3-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose-5-phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0013162 | Fe2+ | Iron(3+) | Periplasmic nitrate reductase | Reduction | RHEA | 34755880 |
MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | ATP hydrolysis; Dehydratase; Dephosphorylation; Gyrase; Nucleic acid synthesis and/or repair; Nucleic acid unzipping and/or repair; Primase; Replicase; Terminase | RHEA | 34755880 |
MMDBr0013186 | 4-Imidazolone-5-propionic acid | Water | Urocanate hydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
MMDBr0013212 | 7-Aminomethyl-7-carbaguanine | 7-Cyano-7-carbaguanine | NADPH-dependent 7-cyano-7-deazaguanine reductase | Reduction | RHEA | 34755880 |
MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Cytidylyltransferase | RHEA | 34755880 |
MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
MMDBr0013226 | Adenosine triphosphate | ADP | Putative thymidylate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013246 | 2-C-methyl-D-erythritol 4-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose 5-phosphate reductoisomerase | Reductoisomerase | RHEA | 34755880 |
MMDBr0013274 | Adenosine triphosphate | ADP | Homoserine kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013280 | D-Arabinose 5-phosphate | 3-deoxy-alpha-D-manno-2-octulosonate-8-phosphate | 2-dehydro-3-deoxyphosphooctonate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
MMDBr0013286 | 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one | 3-Methylthiopropionic acid | Acireductone dioxygenase | Oxygenation | RHEA | 34755880 |
MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
MMDBr0013370 | Adenosine triphosphate | ADP | Glutamate 5-kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013395 | Oxygen | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013422 | LL-2,6-Diaminoheptanedioate | Meso-2,6-Diaminoheptanedioate | Diaminopimelate epimerase | Epimerization; Racemization | RHEA | 34755880 |
MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
MMDBr0013437 | 5-Methylthioribulose 1-phosphate | 5-(methylsulfanyl)-2,3-dioxopentyl phosphate | Probable bifunctional methylthioribose-1-phosphate isomerase/methylthioribulose-1-phosphate dehydratase | Dehydratase; Isomerization | RHEA | 34755880 |
MMDBr0013449 | Hydrogen Ion | Carbon dioxide | 4-hydroxy-4-methyl-2-oxoglutarate aldolase/4-carboxy-4-hydroxy-2-oxoadipate aldolase | Aldol addition (or reverse); Decarboxylation; Redox reaction | RHEA | 34755880 |
MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
MMDBr0013464 | (7R,8S)-7,8-diammoniononanoic acid | Dethiobiotin | Biotin biosynthesis bifunctional protein BioCD | Amine group addition; Synthesis | RHEA | 34755880 |
MMDBr0013466 | Water | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0013488 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
MMDBr0013542 | Formyl-CoA | formate | Formyl-CoA:oxalate CoA-transferase | Transfer of CoA moiety | RHEA | 34755880 |
MMDBr0013547 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0013588 | 1-aminocyclopropane-1-carboxylic acid | 2-oxobutanoic acid | 1-aminocyclopropane-1-carboxylate deaminase | Deamination | RHEA | 34755880 |
MMDBr0013642 | (S)-2,3,4,5-tetrahydrodipicolinate | (S)-2-succinylamino-6-oxoheptanedioic acid | 2,3,4,5-tetrahydropyridine-2,6-dicarboxylate N-succinyltransferase | Succinyltransferase | RHEA | 34755880 |
MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
MMDBr0013729 | Adenosine triphosphate | Adenosine phosphosulfate | Sulfate adenylyltransferase subunit 2 | Adenylyltransferase; Phosphorylation | RHEA | 34755880 |
MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0013784 | D-Glyceraldehyde 3-phosphate | Dihydroxyacetone phosphate | Bifunctional PGK/TIM | Isomerization | RHEA | 34755880 |
MMDBr0013790 | Adenosine triphosphate | ADP | Phosphoenolpyruvate carboxykinase (ATP) | Carboxykinase | RHEA | 34755880 |
MMDBr0013895 | L-Glutamic-gamma-semialdehyde | Hydrogen Ion | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
MMDBr0013896 | Polyphosphate | Polyphosphate | ADP-polyphosphate phosphotransferase | Exopolyphosphatase; Phosphorylation; Transfer of phosphate group | RHEA | 34755880 |
MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Adenylyltransferase | RHEA | 34755880 |
MMDBr0013929 | Hydrogen Ion | Carbon dioxide | Uroporphyrinogen decarboxylase | Decarboxylation | RHEA | 34755880 |
MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Carbamoyltransferase | RHEA | 34755880 |
MMDBr0013952 | 1-(5-phosphoribosyl)-5'-AMP | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | Histidine biosynthesis bifunctional protein HisIE | Cyclohydrolase | RHEA | 34755880 |
MMDBr0013978 | Hydrogen peroxide | Water | Bromoperoxidase-catalase | Catalase; Dimerase; Peroxidation; Synthesis | RHEA | 34755880 |
MMDBr0014005 | Hydrogen Ion | Carbon dioxide | Urease subunit alpha | Urease | RHEA | 34755880 |
MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014068 | 3-Dehydroquinate | 3-Dehydroshikimic acid | Catabolic 3-dehydroquinase | Dehydratase; Dehydroquinase | RHEA | 34755880 |
MMDBr0014083 | Shikimate 3-phosphate | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Pentafunctional AROM polypeptide | Carboxyvinyltransferase | RHEA | 34755880 |
MMDBr0014105 | (S)-malate(2-) | Hydrogen Ion | Malate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
MMDBr0014111 | alpha-Ketoisovaleric acid | 2-Isopropylmalic acid | Isopropyl malate synthase AMT7 | Synthesis | RHEA | 34755880 |
MMDBr0014114 | N-(5-Phospho-D-ribosyl)anthranilate | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | Phosphoribosyl isomerase A | Isomerization | RHEA | 34755880 |
MMDBr0014117 | N-Acetyl-L-glutamate 5-semialdehyde | Hydrogen Ion | Protein ARG5,6, mitochondrial | Reduction | RHEA | 34755880 |
MMDBr0014126 | Adenosine triphosphate | ADP | Glycerol kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014134 | 5-(methylsulfanyl)-2,3-dioxopentyl phosphate | 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one | Enolase-phosphatase E1 | Enolization | RHEA | 34755880 |
MMDBr0014135 | Water | Deoxyadenosine | Adenosylhomocysteinase | Adenosylhomocysteinase | RHEA | 34755880 |
MMDBr0014160 | 3-deoxy-D-arabino-heptulosonate-7-phosphate | 3-Dehydroquinate | Pentafunctional AROM polypeptide | Phosphorylation; Synthesis | RHEA | 34755880 |
MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
MMDBr0014216 | S-(Hydroxymethyl)glutathione | Formaldehyde | Putative glutathione-dependent formaldehyde-activating enzyme | | RHEA | 34755880 |
MMDBr0014221 | Hydrogen Ion | Fe2+ | Deferrochelatase/peroxidase EfeB | Ferrochelatase; Peroxidation | RHEA | 34755880 |
MMDBr0014225 | Water | LL-2,6-Diaminoheptanedioate | Succinyl-diaminopimelate desuccinylase | Desuccinylase | RHEA | 34755880 |
MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
MMDBr0014257 | Adenosine triphosphate | Nicotinic acid adenine dinucleotide | Probable nicotinate-nucleotide adenylyltransferase | Adenylyltransferase; Hydrolysis of bond | RHEA | 34755880 |
MMDBr0014295 | (2R)-3-phosphoglyceric acid | Carbon dioxide | Ribulose bisphosphate carboxylase large chain | Carboxylation | RHEA | 34755880 |
MMDBr0014323 | Adenosine triphosphate | ADP | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
MMDBr0014337 | 3-deoxy-D-manno-2-octulosonate | CMP-3-deoxy-beta-D-manno-octulosonate | 3-deoxy-manno-octulosonate cytidylyltransferase | Cytidylyltransferase | RHEA | 34755880 |
MMDBr0014340 | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | Indole-3-glycerol phosphate synthase | Synthesis | RHEA | 34755880 |
MMDBr0014365 | 4-Imidazolone-5-propionic acid | Formiminoglutamic acid | Imidazolonepropionase | Imidazolonepropionase; Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014367 | Adenine | Hypoxanthine | Adenine deaminase | Deamination | RHEA | 34755880 |
MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Cyclohydrolase; Synthesis | RHEA | 34755880 |
MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
MMDBr0014447 | Adenosine triphosphate | ADP | UMP-CMP kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014459 | 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one | 4-methylsulfanyl-2-oxobutanoic acid | Acireductone dioxygenase | Oxygenation | RHEA | 34755880 |
MMDBr0014466 | 5-Dehydro-4-deoxy-D-glucarate | 2,5-Dioxopentanoate | Probable 5-dehydro-4-deoxyglucarate dehydratase | Dehydratase | RHEA | 34755880 |
MMDBr0014633 | Co-precorrin-5B | Co-precorrin-6A | Cobalt-precorrin-5B C(1)-methyltransferase | Methylation | RHEA | 34755880 |
MMDBr0014686 | Adenosine triphosphate | ADP | D-beta-D-heptose 7-phosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0014688 | D-Sedoheptulose 7-phosphate | D-glycero-alpha-D-manno-heptose 7-phosphate | Phosphoheptose isomerase | Isomerization | RHEA | 34755880 |
MMDBr0014763 | 7-Deaza-7-carboxyguanine | 7-Cyano-7-carbaguanine | 7-cyano-7-deazaguanine synthase | Synthesis | RHEA | 34755880 |
MMDBr0014776 | Farnesyl pyrophosphate | diphosphate | Protoheme IX farnesyltransferase, mitochondrial | Farnesyltransferase | RHEA | 34755880 |
MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation; Phosphatidylglycerophosphatase | RHEA | 34755880 |
MMDBr0014816 | 2'-Deoxyinosine triphosphate | DIMP | Inosine triphosphate pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transferase | RHEA | 34755880 |
MMDBr0014846 | Thymidine 5'-triphosphate | diphosphate | dTTP/UTP pyrophosphatase | Dephosphorylation; Pyrophosphatase | RHEA | 34755880 |
MMDBr0014848 | Water | diphosphate | Inosine triphosphate pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
MMDBr0014908 | Water | diphosphate | dTTP/UTP pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
MMDBr0014909 | Water | diphosphate | Inosine triphosphate pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
MMDBr0015055 | FMNH2 | (Z)-3-Ureidoacrylate | Pyrimidine monooxygenase RutA | Oxygenation | RHEA | 34755880 |
MMDBr0015056 | FMNH2 | (Z)-2-methylureidoacrylic acid | Pyrimidine monooxygenase RutA | Oxygenation | RHEA | 34755880 |
MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Dehydratase; Isomerization | RHEA | 34755880 |
MMDBr0015213 | Hydrogen Ion | 3,8-divinyl protochlorophyllide a | Aerobic magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase | Cycle formation | RHEA | 34755880 |
MMDBr0015402 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015405 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
MMDBr0015480 | Phosphoribosyl pyrophosphate | ADP | Probable nicotinate phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
MMDBr0015518 | D-Ribulose 1,5-bisphosphate | (2R)-3-phosphoglyceric acid | Ribulose bisphosphate carboxylase large chain | Carboxylation | RHEA | 34755880 |
MMDBr0015916 | 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (flavodoxin) | Synthesis | RHEA | 34755880 |
MMDBr0016813 | 2-Aminobenzoic acid | 2-(4-dimethylaminophenyl)diazenylbenzoic acid | FMN-dependent NADPH-azoreductase | FMN-dependent NADPH-azoreductase; Redox reaction | RHEA | 34755880 |
MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | | RHEA | 34755880 |
MMDBr0017852 | Adenosine triphosphate | ADP | Glutamate--cysteine ligase EgtA | | RHEA | 34755880 |
MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | | RHEA | 34755880 |
MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | | RHEA | 34755880 |
MMDBr0017879 | Adenosine triphosphate | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | Phosphoribosylformylglycinamidine synthase | | RHEA | 34755880 |
MMDBr0017897 | Adenosine triphosphate | diphosphate | S-adenosylmethionine synthase | | RHEA | 34755880 |
MMDBr0017903 | L-Histidine | Ammonium | Histidine ammonia-lyase | | RHEA | 34755880 |
MMDBr0017914 | L-Tryptophan | N-Formyl-L-kynurenine | Indoleamine 2,3-dioxygenase nanC | | RHEA | 34755880 |
MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | | RHEA | 34755880 |
MMDBr0017917 | 5-Aminoimidazole ribonucleotide | 4-Amino-2-methyl-5-phosphomethylpyrimidine | Phosphomethylpyrimidine synthase | | RHEA | 34755880 |
MMDBr0017926 | Adenosine triphosphate | ADP | CTP synthase | | RHEA | 34755880 |
MMDBr0024389 | Adenosine triphosphate | diphosphate | Leucine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024401 | L-Serine | Hydrogen Ion | Holo-[acyl-carrier-protein] synthase | | RHEA | 34755880 |
MMDBr0024403 | Hydrogen Ion | Carbon dioxide | 3-oxoacyl-[acyl-carrier-protein] synthase 3 | | RHEA | 34755880 |
MMDBr0024411 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024424 | S-Adenosylmethionine | S-Adenosylhomocysteine | Protein-L-isoaspartate O-methyltransferase | | RHEA | 34755880 |
MMDBr0024459 | Uridine triphosphate | diphosphate | Bifunctional uridylyltransferase/uridylyl-removing enzyme | | RHEA | 34755880 |
MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | | RHEA | 34755880 |
MMDBr0024483 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | | RHEA | 34755880 |
MMDBr0024522 | Adenosine triphosphate | diphosphate | Glycine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024539 | Hydrogen Ion | 5'-Deoxyadenosine | Lipoyl synthase | | RHEA | 34755880 |
MMDBr0024546 | Hydrogen Ion | (6S)-5,6,7,8-tetrahydrofolic acid | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO | | RHEA | 34755880 |
MMDBr0024568 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | | RHEA | 34755880 |
MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | | RHEA | 34755880 |
MMDBr0024597 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp/Asn) ligase | | RHEA | 34755880 |
MMDBr0024602 | Adenosine triphosphate | diphosphate | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | | RHEA | 34755880 |
MMDBr0024628 | Adenosine triphosphate | Hydrogen Ion | Phenylalanine--tRNA ligase beta subunit | | RHEA | 34755880 |
MMDBr0024630 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase A | | RHEA | 34755880 |
MMDBr0024650 | Hydrogen Ion | di-mu-Sulfido-diiron(2+) | Ferredoxin--NADP reductase | | RHEA | 34755880 |
MMDBr0024656 | Adenosine triphosphate | diphosphate | Arginine--tRNA ligase | | RHEA | 34755880 |
MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | | RHEA | 34755880 |
MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | | RHEA | 34755880 |
MMDBr0024774 | Hydrogen Ion | Carbon dioxide | Probable glycine dehydrogenase (decarboxylating) subunit 1 | | RHEA | 34755880 |
MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | | RHEA | 34755880 |
MMDBr0024779 | Water | formate | Peptide deformylase 1 | | RHEA | 34755880 |
MMDBr0024808 | 1-Deoxy-D-xylulose 5-phosphate | Water | Thiazole synthase | | RHEA | 34755880 |
MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | | RHEA | 34755880 |
MMDBr0024825 | Hydrogen Ion | diphosphate | Bifunctional protein HldE | | RHEA | 34755880 |
MMDBr0024833 | Tetra-mu3-sulfido-tetrairon(2+) | Water | Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein | | RHEA | 34755880 |
MMDBr0024834 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone/menaquinone biosynthesis C-methyltransferase UbiE | | RHEA | 34755880 |
MMDBr0024851 | L-Dihydroorotic acid | orotate | Dihydroorotate dehydrogenase (quinone) | | RHEA | 34755880 |
MMDBr0024883 | S-Adenosylmethionine | Hydrogen Ion | S-adenosylmethionine:tRNA ribosyltransferase-isomerase | | RHEA | 34755880 |
MMDBr0024925 | Glycerol 3-phosphate | Phosphate | Glycerol-3-phosphate acyltransferase | | RHEA | 34755880 |
MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | | RHEA | 34755880 |
MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | | RHEA | 34755880 |
MMDBr0024977 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein S12 methylthiotransferase RimO | | RHEA | 34755880 |
MMDBr0025060 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | | RHEA | 34755880 |
MMDBr0025066 | S-Adenosylmethionine | Hydrogen Ion | Demethylmenaquinone methyltransferase | | RHEA | 34755880 |
MMDBr0025075 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase E | | RHEA | 34755880 |
MMDBr0025078 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase G | | RHEA | 34755880 |
MMDBr0025085 | S-Adenosylmethionine | Hydrogen Ion | Putative ribosomal RNA large subunit methyltransferase H | | RHEA | 34755880 |
MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | | RHEA | 34755880 |
MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | | RHEA | 34755880 |
MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | | RHEA | 34755880 |
MMDBr0025163 | ADP | Hydrogen Ion | Putative pyruvate, phosphate dikinase regulatory protein 1 | | RHEA | 34755880 |
MMDBr0025164 | Hydrogen Ion | diphosphate | Putative pyruvate, phosphate dikinase regulatory protein 1 | | RHEA | 34755880 |
MMDBr0025165 | Phosphate | L-Tyrosine | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | | RHEA | 34755880 |
MMDBr0025167 | Adenosine triphosphate | Hydrogen Ion | tRNA(Ile)-lysidine synthase | | RHEA | 34755880 |
MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | | RHEA | 34755880 |
MMDBr0025216 | Hydrogen Ion | NAD | NAD(P)H dehydrogenase (quinone) | | RHEA | 34755880 |
MMDBr0025217 | Hydrogen Ion | NADP(+) | NAD(P)H dehydrogenase (quinone) | | RHEA | 34755880 |
MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | | RHEA | 34755880 |
MMDBr0025493 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase MntA | | RHEA | 34755880 |
MMDBr0025494 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
MMDBr0025495 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
MMDBr0025496 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
MMDBr0025514 | Acetyl-CoA | Malonyl-CoA | Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha | | RHEA | 34755880 |
MMDBr0025650 | Hydrogen Ion | Hydrogen Ion | NADH-quinone oxidoreductase subunit C/D | | RHEA | 34755880 |
MMDBr0025654 | L-Serine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
MMDBr0025655 | L-Serine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
MMDBr0025777 | Hydrogen Ion | (6S)-5,6,7,8-tetrahydrofolic acid | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO | | RHEA | 34755880 |
MMDBr0025806 | Water | Fe(II)-heme a | Heme A synthase | | RHEA | 34755880 |
MMDBr0025807 | Water | Fe(II)-heme a | Heme A synthase | | RHEA | 34755880 |
MMDBr0025921 | Hydrogen Ion | NAD | FMN-dependent NADH:quinone oxidoreductase | | RHEA | 34755880 |
MMDBr0026014 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026015 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026016 | Phosphate | Guanosine 3',5'-bis(diphosphate) | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026017 | Phosphate | Adenosine diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
MMDBr0026022 | Adenosine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026023 | Cytidine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026024 | Uridine 5'-monophosphate | Uridine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026025 | Guanosine monophosphate | Guanosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |