| MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
| MMDBr0012895 | diphosphate | Phosphoribosyl pyrophosphate | Orotate phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012927 | 3a-(2-amino-2-carboxyethyl)-4,5-dioxo-4,5,6,7,8,9-hexahydroquinoline-7,9-dicarboxylic acid | Hydrogen Ion | Pyrroloquinoline-quinone synthase | Synthesis | RHEA | 34755880 |
| MMDBr0012943 | diphosphate | Phosphoribosyl pyrophosphate | Xanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012944 | Phosphoribosyl pyrophosphate | diphosphate | Xanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012954 | Adenosine triphosphate | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0012970 | D-erythro-1-(Imidazol-4-yl)glycerol 3-phosphate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Imidazoleglycerol-phosphate dehydratase | Dehydratase | RHEA | 34755880 |
| MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
| MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012989 | Adenosine triphosphate | ADP | D-alanine--D-alanine ligase | Ligation | RHEA | 34755880 |
| MMDBr0013038 | diphosphate | Phosphoribosyl pyrophosphate | Tryptophan biosynthesis protein TrpCD | Phosphoribosyltransferase; Synthesis | RHEA | 34755880 |
| MMDBr0013045 | Alpha-D-glucose 6-phosphate | beta-D-Fructose 6-phosphate | Glucose-6-phosphate isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Hydroxymethyltransferase | RHEA | 34755880 |
| MMDBr0013081 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 7,8-dihydrofolate monoglutamate | Bifunctional dihydrofolate reductase-thymidylate synthase | Reduction; Synthesis | RHEA | 34755880 |
| MMDBr0013083 | Glucose 1-phosphate | ADP-alpha-D-glucose | Glucose-1-phosphate adenylyltransferase | Adenylyltransferase | RHEA | 34755880 |
| MMDBr0013098 | NADP(+) | Hydrogen Ion | UDP-N-acetylenolpyruvoylglucosamine reductase | Reduction | RHEA | 34755880 |
| MMDBr0013152 | L-Glutamic acid | D-Glutamate | L-alanine/L-glutamate racemase | Racemization; Synthesis | RHEA | 34755880 |
| MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | ATP hydrolysis; Dehydratase; Dephosphorylation; Gyrase; Nucleic acid synthesis and/or repair; Nucleic acid unzipping and/or repair; Primase; Replicase; Terminase | RHEA | 34755880 |
| MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Cytidylyltransferase | RHEA | 34755880 |
| MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
| MMDBr0013224 | Hydrogen Ion | diphosphate | Bifunctional protein GlmU | Acetyltransferase; Pyrophosphorylase | RHEA | 34755880 |
| MMDBr0013245 | Acetyl-CoA | CoA | L-serine/homoserine O-acetyltransferase | Acetyltransferase | RHEA | 34755880 |
| MMDBr0013246 | 2-C-methyl-D-erythritol 4-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose 5-phosphate reductoisomerase | Reductoisomerase | RHEA | 34755880 |
| MMDBr0013248 | Acetyl-CoA | CoA | Bifunctional protein GlmU | Acetyltransferase | RHEA | 34755880 |
| MMDBr0013309 | Phosphoglycolic acid | Glycolic acid | Phosphoglycolate phosphatase | Dephosphorylation | RHEA | 34755880 |
| MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
| MMDBr0013339 | aldehydo-D-ribose 5-phosphate | D-Ribulose 5-phosphate | Bifunctional ribokinase/ribose-5-phosphate isomerase A | Isomerization | RHEA | 34755880 |
| MMDBr0013357 | (2R)-3-phosphoglyceric acid | (2R)-3-phospho-glyceroyl phosphate | Phosphoglycerate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013405 | Iron(3+) | Fe2+ | Copper-containing nitrite reductase | Reduction | RHEA | 34755880 |
| MMDBr0013411 | Betaine aldehyde | Glycine betaine | Probable betaine aldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013412 | Betaine aldehyde | Glycine betaine | Betaine aldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
| MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
| MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
| MMDBr0013529 | Adenosine triphosphate | ADP | UDP-N-acetylmuramoylalanine--D-glutamate ligase | Ligation | RHEA | 34755880 |
| MMDBr0013547 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
| MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013550 | (S)-malyl-CoA | Acetyl-CoA | Apparent malate synthase | Non-hydrolytic bond cleavage (or its reversal); Synthesis | RHEA | 34755880 |
| MMDBr0013611 | D-Glyceraldehyde 3-phosphate | beta-D-Fructose 6-phosphate | Transaldolase | Transfer of aldol group | RHEA | 34755880 |
| MMDBr0013642 | (S)-2,3,4,5-tetrahydrodipicolinate | (S)-2-succinylamino-6-oxoheptanedioic acid | 2,3,4,5-tetrahydropyridine-2,6-dicarboxylate N-succinyltransferase | Succinyltransferase | RHEA | 34755880 |
| MMDBr0013659 | Guanosine triphosphate | 7,8-dihydroneopterin 3'-triphosphate | Bifunctional protein FolKE | Cyclohydrolase | RHEA | 34755880 |
| MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
| MMDBr0013681 | NADP(+) | 3-Dehydroshikimic acid | Pentafunctional AROM polypeptide | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013708 | diphosphate | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013709 | Phosphoribosyl pyrophosphate | diphosphate | Hypoxanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013770 | Water | Phosphoribosyl formamidocarboxamide | Bifunctional purine biosynthesis protein PurH | Cyclohydrolase | RHEA | 34755880 |
| MMDBr0013790 | Adenosine triphosphate | ADP | Phosphoenolpyruvate carboxykinase (ATP) | Carboxykinase | RHEA | 34755880 |
| MMDBr0013792 | Adenosine triphosphate | ADP | NAD kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013801 | Phosphoenolpyruvic acid | Phosphate | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | Carboxyvinyltransferase | RHEA | 34755880 |
| MMDBr0013908 | Guanosine triphosphate | Guanosine diphosphate | GTPase ArgK | Dephosphorylation; GTP hydrolysis; Intramolecular transfer of functional group; Nucleic acid synthesis and/or repair; Phytase | RHEA | 34755880 |
| MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Adenylyltransferase | RHEA | 34755880 |
| MMDBr0013929 | Hydrogen Ion | Carbon dioxide | Uroporphyrinogen decarboxylase | Decarboxylation | RHEA | 34755880 |
| MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Carbamoyltransferase | RHEA | 34755880 |
| MMDBr0013952 | 1-(5-phosphoribosyl)-5'-AMP | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | Histidine biosynthesis bifunctional protein HisIE | Cyclohydrolase | RHEA | 34755880 |
| MMDBr0013966 | (6S)-5,6,7,8-tetrahydrofolic acid | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Ligation; Synthesis | RHEA | 34755880 |
| MMDBr0013970 | L-Alanine | D-Alanine | L-alanine/L-glutamate racemase | Racemization | RHEA | 34755880 |
| MMDBr0013978 | Hydrogen peroxide | Water | Bromoperoxidase-catalase | Catalase; Dimerase; Peroxidation; Synthesis | RHEA | 34755880 |
| MMDBr0014005 | Hydrogen Ion | Carbon dioxide | Urease subunit alpha | Urease | RHEA | 34755880 |
| MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014105 | (S)-malate(2-) | Hydrogen Ion | Malate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0014117 | N-Acetyl-L-glutamate 5-semialdehyde | Hydrogen Ion | Protein ARG5,6, mitochondrial | Reduction | RHEA | 34755880 |
| MMDBr0014126 | Adenosine triphosphate | ADP | Glycerol kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014160 | 3-deoxy-D-arabino-heptulosonate-7-phosphate | 3-Dehydroquinate | Pentafunctional AROM polypeptide | Phosphorylation; Synthesis | RHEA | 34755880 |
| MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
| MMDBr0014180 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional purine biosynthesis protein PurH | | RHEA | 34755880 |
| MMDBr0014225 | Water | LL-2,6-Diaminoheptanedioate | Succinyl-diaminopimelate desuccinylase | Desuccinylase | RHEA | 34755880 |
| MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
| MMDBr0014254 | D-Xylose | D-Xylulose | Xylose isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014256 | 1-(5-phosphoribosyl)-ATP | 1-(5-phosphoribosyl)-5'-AMP | Phosphoribosyl-ATP pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
| MMDBr0014257 | Adenosine triphosphate | Nicotinic acid adenine dinucleotide | Probable nicotinate-nucleotide adenylyltransferase | Adenylyltransferase; Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0014282 | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | 5-Aminoimidazole ribonucleotide | Bifunctional purine biosynthetic protein ADE5,7 | Ligation | RHEA | 34755880 |
| MMDBr0014295 | (2R)-3-phosphoglyceric acid | Carbon dioxide | Ribulose bisphosphate carboxylase large chain | Carboxylation | RHEA | 34755880 |
| MMDBr0014311 | Isopentenyl pyrophosphate | Dimethylallylpyrophosphate | Isopentenyl-diphosphate Delta-isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014323 | Adenosine triphosphate | ADP | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
| MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
| MMDBr0014340 | 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | Indole-3-glycerol phosphate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014367 | Adenine | Hypoxanthine | Adenine deaminase | Deamination | RHEA | 34755880 |
| MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Cyclohydrolase; Synthesis | RHEA | 34755880 |
| MMDBr0014377 | alpha-Ketoglutarate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Histidinol-phosphate aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
| MMDBr0014393 | 5-Dehydro-4-deoxy-D-glucuronate | (4S)-4,6-Dihydroxy-2,5-dioxohexanoate | 4-deoxy-L-threo-5-hexosulose-uronate ketol-isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0014426 | 4-Methyl-5-(2-hydroxyethyl)-thiazole | 4-methyl-5-(2-phosphooxyethyl)-thiazole | Probable thiamine biosynthetic bifunctional enzyme | Phosphorylation | RHEA | 34755880 |
| MMDBr0014437 | L-Dihydroorotic acid | Hydrogen Ion | Dihydroorotase | Dihydroorotase | RHEA | 34755880 |
| MMDBr0014447 | Adenosine triphosphate | ADP | UMP-CMP kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014556 | diphosphate | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0014557 | Phosphoribosyl pyrophosphate | diphosphate | Hypoxanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0014776 | Farnesyl pyrophosphate | diphosphate | Protoheme IX farnesyltransferase, mitochondrial | Farnesyltransferase | RHEA | 34755880 |
| MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation; Phosphatidylglycerophosphatase | RHEA | 34755880 |
| MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transferase | RHEA | 34755880 |
| MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
| MMDBr0015136 | 3-Isopropylmalate | 2-Isopropylmalic acid | 3-isopropylmalate dehydratase large subunit gloJ | Dehydratase; Isomerization | RHEA | 34755880 |
| MMDBr0015316 | L-Aspartate-semialdehyde | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0015402 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
| MMDBr0015405 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
| MMDBr0015518 | D-Ribulose 1,5-bisphosphate | (2R)-3-phosphoglyceric acid | Ribulose bisphosphate carboxylase large chain | Carboxylation | RHEA | 34755880 |
| MMDBr0015625 | (2R,3S)-beta-methylmalyl-CoA | glyoxylate | L-malyl-CoA/beta-methylmalyl-CoA lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0015633 | (S)-malyl-CoA | (S)-malate(2-) | Apparent malate synthase | Synthesis; Thioesterase | RHEA | 34755880 |
| MMDBr0016462 | (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate | Cyclic pyranopterin monophosphate | Cyclic pyranopterin monophosphate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
| MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | | RHEA | 34755880 |
| MMDBr0017843 | Adenosine triphosphate | Adenosine monophosphate | GMP synthase [glutamine-hydrolyzing] | | RHEA | 34755880 |
| MMDBr0017869 | Coproporphyrinogen III | 5'-Deoxyadenosine | Coproporphyrinogen III oxidase, anaerobic 1 | | RHEA | 34755880 |
| MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | | RHEA | 34755880 |
| MMDBr0017879 | Adenosine triphosphate | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | Phosphoribosylformylglycinamidine synthase | | RHEA | 34755880 |
| MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | | RHEA | 34755880 |
| MMDBr0017926 | Adenosine triphosphate | ADP | CTP synthase | | RHEA | 34755880 |
| MMDBr0024345 | Adenosine triphosphate | Hydrogen Ion | Tyrosine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024389 | Adenosine triphosphate | diphosphate | Leucine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024401 | L-Serine | Hydrogen Ion | Holo-[acyl-carrier-protein] synthase | | RHEA | 34755880 |
| MMDBr0024403 | Hydrogen Ion | Carbon dioxide | 3-oxoacyl-[acyl-carrier-protein] synthase 3 | | RHEA | 34755880 |
| MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024424 | S-Adenosylmethionine | S-Adenosylhomocysteine | Protein-L-isoaspartate O-methyltransferase | | RHEA | 34755880 |
| MMDBr0024449 | Adenosine triphosphate | diphosphate | Methionine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024483 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | | RHEA | 34755880 |
| MMDBr0024533 | Water | Ammonium | Probable chemoreceptor glutamine deamidase CheD | | RHEA | 34755880 |
| MMDBr0024539 | Hydrogen Ion | 5'-Deoxyadenosine | Lipoyl synthase | | RHEA | 34755880 |
| MMDBr0024546 | Hydrogen Ion | (6S)-5,6,7,8-tetrahydrofolic acid | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO | | RHEA | 34755880 |
| MMDBr0024568 | Water | Hydrogen Ion | Aspartyl/glutamyl-tRNA(Asn/Gln) amidotransferase subunit C | | RHEA | 34755880 |
| MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | | RHEA | 34755880 |
| MMDBr0024593 | ADP-alpha-D-glucose | Hydrogen Ion | Probable glycogen synthase | | RHEA | 34755880 |
| MMDBr0024597 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp/Asn) ligase | | RHEA | 34755880 |
| MMDBr0024630 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase A | | RHEA | 34755880 |
| MMDBr0024656 | Adenosine triphosphate | diphosphate | Arginine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024774 | Hydrogen Ion | Carbon dioxide | Probable glycine dehydrogenase (decarboxylating) subunit 1 | | RHEA | 34755880 |
| MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | | RHEA | 34755880 |
| MMDBr0024782 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | | RHEA | 34755880 |
| MMDBr0024787 | Adenosine triphosphate | Hydrogen Ion | Threonine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024789 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | | RHEA | 34755880 |
| MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | | RHEA | 34755880 |
| MMDBr0024833 | Tetra-mu3-sulfido-tetrairon(2+) | Water | Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein | | RHEA | 34755880 |
| MMDBr0024834 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone/menaquinone biosynthesis C-methyltransferase UbiE | | RHEA | 34755880 |
| MMDBr0024875 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone biosynthesis O-methyltransferase | | RHEA | 34755880 |
| MMDBr0024883 | S-Adenosylmethionine | Hydrogen Ion | S-adenosylmethionine:tRNA ribosyltransferase-isomerase | | RHEA | 34755880 |
| MMDBr0024925 | Glycerol 3-phosphate | Phosphate | Glycerol-3-phosphate acyltransferase | | RHEA | 34755880 |
| MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | | RHEA | 34755880 |
| MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | | RHEA | 34755880 |
| MMDBr0024977 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein S12 methylthiotransferase RimO | | RHEA | 34755880 |
| MMDBr0025066 | S-Adenosylmethionine | Hydrogen Ion | Demethylmenaquinone methyltransferase | | RHEA | 34755880 |
| MMDBr0025078 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase G | | RHEA | 34755880 |
| MMDBr0025085 | S-Adenosylmethionine | Hydrogen Ion | Putative ribosomal RNA large subunit methyltransferase H | | RHEA | 34755880 |
| MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | | RHEA | 34755880 |
| MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | | RHEA | 34755880 |
| MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | | RHEA | 34755880 |
| MMDBr0025190 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone biosynthesis O-methyltransferase | | RHEA | 34755880 |
| MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | | RHEA | 34755880 |
| MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | | RHEA | 34755880 |
| MMDBr0025493 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase MntA | | RHEA | 34755880 |
| MMDBr0025494 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025495 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025496 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025514 | Acetyl-CoA | Malonyl-CoA | Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha | | RHEA | 34755880 |
| MMDBr0025620 | L-Cysteine | Hydrogen Ion | Phosphatidylglycerol--prolipoprotein diacylglyceryl transferase | | RHEA | 34755880 |
| MMDBr0025638 | Adenosine triphosphate | Hydrogen Ion | tRNA-cytidine(32) 2-sulfurtransferase | | RHEA | 34755880 |
| MMDBr0025639 | Adenosine triphosphate | Hydrogen Ion | tRNA-cytidine(32) 2-sulfurtransferase | | RHEA | 34755880 |
| MMDBr0025650 | Hydrogen Ion | Hydrogen Ion | NADH-quinone oxidoreductase subunit C/D | | RHEA | 34755880 |
| MMDBr0025654 | L-Serine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025655 | L-Serine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025777 | Hydrogen Ion | (6S)-5,6,7,8-tetrahydrofolic acid | Methylenetetrahydrofolate--tRNA-(uracil-5-)-methyltransferase TrmFO | | RHEA | 34755880 |
| MMDBr0025806 | Water | Fe(II)-heme a | Heme A synthase | | RHEA | 34755880 |
| MMDBr0025807 | Water | Fe(II)-heme a | Heme A synthase | | RHEA | 34755880 |
| MMDBr0026014 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
| MMDBr0026015 | Phosphate | Uridine 5'-diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
| MMDBr0026016 | Phosphate | Guanosine 3',5'-bis(diphosphate) | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
| MMDBr0026017 | Phosphate | Adenosine diphosphate | Ribonuclease PH | RNA degradation | RHEA | 34755880 |
| MMDBr0026022 | Adenosine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026023 | Cytidine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026024 | Uridine 5'-monophosphate | Uridine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026025 | Guanosine monophosphate | Guanosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |