| MMDBr0012860 | (2R)-2-phosphoglyceric acid | Water | Enolase | Enolization | RHEA | 34755880 |
| MMDBr0012867 | (1R,6R)-6-Hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate | 2-Succinylbenzoate | o-succinylbenzoate synthase | Racemization; Synthesis | RHEA | 34755880 |
| MMDBr0012872 | Adenosine triphosphate | ADP | Putative pyridoxal kinase BUD16 | Phosphorylation | RHEA | 34755880 |
| MMDBr0012876 | Deoxyuridine triphosphate | diphosphate | Probable deoxyuridine 5'-triphosphate nucleotidohydrolase | Dephosphorylation; Nucleotidohydrolase | RHEA | 34755880 |
| MMDBr0012878 | 2-Dehydro-3-deoxy-D-glucarate | 2-Hydroxy-3-oxopropanoate | 5-keto-4-deoxy-D-glucarate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
| MMDBr0012889 | Pyroglutamic acid | ADP | 5-oxoprolinase | oxoprolinase | RHEA | 34755880 |
| MMDBr0012895 | diphosphate | Phosphoribosyl pyrophosphate | Orotate phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012943 | diphosphate | Phosphoribosyl pyrophosphate | Xanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012944 | Phosphoribosyl pyrophosphate | diphosphate | Xanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012946 | Water | Hydrogen Ion | N-succinylglutamate 5-semialdehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0012953 | (R)-Pantoate | Pantothenic acid | Pantothenate synthetase | Ligation; Phosphorylation; Synthesis | RHEA | 34755880 |
| MMDBr0012954 | Adenosine triphosphate | Argininosuccinic acid | Argininosuccinate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0012961 | Glycolic acid | glyoxylate | Glyoxylate/hydroxypyruvate reductase A | Reduction | RHEA | 34755880 |
| MMDBr0012971 | beta-D-Fructose 1,6-bisphosphate | beta-D-Fructose 6-phosphate | Fructose-1,6-bisphosphatase/inositol-1-monophosphatase | Aldol addition (or reverse); Dephosphorylation | RHEA | 34755880 |
| MMDBr0012975 | NAD | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(+)] | Dehydrogenation | RHEA | 34755880 |
| MMDBr0012976 | NADP(+) | Dihydroxyacetone phosphate | Glycerol-3-phosphate dehydrogenase [NAD(P)+] | Dehydrogenation | RHEA | 34755880 |
| MMDBr0012978 | Cyanate | Carbon dioxide | Cyanate hydratase | Hydration/dehydration of C-O bond | RHEA | 34755880 |
| MMDBr0012988 | 5,6-Dimethylbenzimidazole | N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole | Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0012992 | D-Cysteine | Hydrogen Ion | D-cysteine desulfhydrase | Desulfhydrase | RHEA | 34755880 |
| MMDBr0012996 | (S)-Ureidoglycolic acid | glyoxylate | Ureidoglycolate lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0013026 | Hydrogen Ion | Carbon dioxide | Orotidine 5'-phosphate decarboxylase | Decarboxylation | RHEA | 34755880 |
| MMDBr0013027 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013032 | NAD | NADH | Soluble pyridine nucleotide transhydrogenase | pyridine nucleotide transhydrogenase | RHEA | 34755880 |
| MMDBr0013043 | Water | Adenosine monophosphate | NAD-capped RNA hydrolase | Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0013045 | Alpha-D-glucose 6-phosphate | beta-D-Fructose 6-phosphate | Glucose-6-phosphate isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013046 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | 3-methyl-2-oxobutanoate hydroxymethyltransferase | Hydroxymethyltransferase | RHEA | 34755880 |
| MMDBr0013071 | Adenosine triphosphate | ADP | Thiamine kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013075 | D-Erythrose 4-phosphate | 4-Phospho-D-erythronate | D-erythrose-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013083 | Glucose 1-phosphate | ADP-alpha-D-glucose | Glucose-1-phosphate adenylyltransferase | Adenylyltransferase | RHEA | 34755880 |
| MMDBr0013088 | Glucosamine 6-phosphate | beta-D-Fructose 6-phosphate | D-galactosamine-6-phosphate deaminase AgaS | Deamination; Isomerization | RHEA | 34755880 |
| MMDBr0013101 | alpha-Ketoglutarate | 1-Pyrroline | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0013102 | alpha-Ketoglutarate | 1-Pyrroline | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0013130 | 6-Phosphonoglucono-D-lactone | 6-Phosphogluconic acid | 6-phosphogluconolactonase | 6-phosphogluconolactonase | RHEA | 34755880 |
| MMDBr0013134 | D-Glyceraldehyde 3-phosphate | 1-Deoxy-D-xylulose 5-phosphate | 1-deoxy-D-xylulose-5-phosphate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0013140 | (S)-malate(2-) | Carbon dioxide | NAD-dependent malic enzyme | Redox reaction | RHEA | 34755880 |
| MMDBr0013143 | Putrescine | Hydrogen Ion | Polyamine aminopropyltransferase | Aminopropyltransferase; Synthesis; Transferase | RHEA | 34755880 |
| MMDBr0013152 | L-Glutamic acid | D-Glutamate | L-alanine/L-glutamate racemase | Racemization; Synthesis | RHEA | 34755880 |
| MMDBr0013162 | Fe2+ | Iron(3+) | Periplasmic nitrate reductase | Reduction | RHEA | 34755880 |
| MMDBr0013170 | Adenosine monophosphate | ADP | Adenylate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013173 | diphosphate | Phosphoribosyl pyrophosphate | Bifunctional protein PyrR | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013178 | D-Glucuronic acid | D-Fructofuranuronic acid | Uronate isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013179 | Adenosine triphosphate | ADP | Replicase large subunit | ATP hydrolysis; Dehydratase; Dephosphorylation; Gyrase; Nucleic acid synthesis and/or repair; Nucleic acid unzipping and/or repair; Primase; Replicase; Terminase | RHEA | 34755880 |
| MMDBr0013183 | Guanosine 3'-diphosphate 5'-triphosphate | Guanosine 3',5'-bis(diphosphate) | Guanosine-5'-triphosphate,3'-diphosphate pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
| MMDBr0013185 | Iron(3+) | Fe2+ | Cytochrome c-552 | Reduction | RHEA | 34755880 |
| MMDBr0013187 | Adenosine triphosphate | Shikimate 3-phosphate | Pentafunctional AROM polypeptide | Phosphorylation | RHEA | 34755880 |
| MMDBr0013194 | Water | Hydroxymethylbilane | Porphobilinogen deaminase | Deamination | RHEA | 34755880 |
| MMDBr0013201 | Guanosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Phosphorylation | RHEA | 34755880 |
| MMDBr0013212 | 7-Aminomethyl-7-carbaguanine | 7-Cyano-7-carbaguanine | NADPH-dependent 7-cyano-7-deazaguanine reductase | Reduction | RHEA | 34755880 |
| MMDBr0013213 | 2-C-methyl-D-erythritol 4-phosphate | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase | Cytidylyltransferase | RHEA | 34755880 |
| MMDBr0013214 | Deoxycytidine | 2'-Deoxyuridine | Cytidine deaminase | Deamination | RHEA | 34755880 |
| MMDBr0013221 | (R)-2,3-Dihydroxy-3-methylpentanoate | (S)-2-ethyl-2-hydroxy-3-oxobutanoic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
| MMDBr0013224 | Hydrogen Ion | diphosphate | Bifunctional protein GlmU | Acetyltransferase; Pyrophosphorylase | RHEA | 34755880 |
| MMDBr0013226 | Adenosine triphosphate | ADP | Putative thymidylate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013236 | Water | 5-Methylthioribose | Aminodeoxyfutalosine nucleosidase | Nucleosidase | RHEA | 34755880 |
| MMDBr0013248 | Acetyl-CoA | CoA | Bifunctional protein GlmU | Acetyltransferase | RHEA | 34755880 |
| MMDBr0013253 | alpha-Ketoglutarate | L-2-Hydroxyglutaric acid | Glutarate 2-hydroxylase | Hydroxylation | RHEA | 34755880 |
| MMDBr0013254 | alpha-Ketoglutarate | L-2-Hydroxyglutaric acid | Glutarate 2-hydroxylase | Hydroxylation | RHEA | 34755880 |
| MMDBr0013264 | Agmatine | Putrescine | Agmatinase | Agmatinase; Agmatinase 1; Ureohydrolase | RHEA | 34755880 |
| MMDBr0013273 | D-Serine | Ammonium | D-serine dehydratase | Dehydratase; Racemization | RHEA | 34755880 |
| MMDBr0013274 | Adenosine triphosphate | ADP | Homoserine kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013280 | D-Arabinose 5-phosphate | 3-deoxy-alpha-D-manno-2-octulosonate-8-phosphate | 2-dehydro-3-deoxyphosphooctonate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
| MMDBr0013295 | (S)-4-Amino-5-oxopentanoate | 5-Aminolevulinic acid | Glutamate-1-semialdehyde 2,1-aminomutase | Aminomutase | RHEA | 34755880 |
| MMDBr0013303 | alpha-Ketoglutarate | 3-Phosphonatooxypyruvate(3-) | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0013305 | 3-Dehydro-L-gulonate 6-phosphate | Carbon dioxide | 3-keto-L-gulonate-6-phosphate decarboxylase SgbH | Decarboxylation | RHEA | 34755880 |
| MMDBr0013333 | Adenosine triphosphate | ADP | Protein ARG5,6, mitochondrial | Phosphorylation | RHEA | 34755880 |
| MMDBr0013339 | aldehydo-D-ribose 5-phosphate | D-Ribulose 5-phosphate | Bifunctional ribokinase/ribose-5-phosphate isomerase A | Isomerization | RHEA | 34755880 |
| MMDBr0013370 | Adenosine triphosphate | ADP | Glutamate 5-kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013375 | Water | formate | S-formylglutathione hydrolase | Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0013376 | S-Adenosylmethionine | (E)-3-(Methoxycarbonyl)pent-2-enedioate | Trans-aconitate 2-methyltransferase | Methylation | RHEA | 34755880 |
| MMDBr0013395 | Oxygen | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
| MMDBr0013397 | Water | L-Glutamic acid | Succinylglutamate desuccinylase | Desuccinylase | RHEA | 34755880 |
| MMDBr0013399 | L-Arginine | CoA | Arginine N-succinyltransferase | Succinyltransferase | RHEA | 34755880 |
| MMDBr0013401 | dGTP | Deoxyguanosine | Deoxyguanosinetriphosphate triphosphohydrolase | Triphosphohydrolase | RHEA | 34755880 |
| MMDBr0013411 | Betaine aldehyde | Glycine betaine | Probable betaine aldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013412 | Betaine aldehyde | Glycine betaine | Betaine aldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013413 | Ethanolamine | Acetaldehyde | Ethanolamine ammonia-lyase large subunit | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0013418 | (4S)-4,5-Dihydroxypentan-2,3-dione | (2S)-2-hydroxy-3,4-dioxopentyl phosphate | Autoinducer-2 kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013422 | LL-2,6-Diaminoheptanedioate | Meso-2,6-Diaminoheptanedioate | Diaminopimelate epimerase | Epimerization; Racemization | RHEA | 34755880 |
| MMDBr0013431 | 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013445 | NAD | Hydrogen Ion | Siroheme synthase | Dehydrogenation; Synthesis | RHEA | 34755880 |
| MMDBr0013449 | Hydrogen Ion | Carbon dioxide | 4-hydroxy-4-methyl-2-oxoglutarate aldolase/4-carboxy-4-hydroxy-2-oxoadipate aldolase | Aldol addition (or reverse); Decarboxylation; Redox reaction | RHEA | 34755880 |
| MMDBr0013451 | Carbamate | Carbon dioxide | Putative aminoacrylate hydrolase RutD | Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0013458 | Guanosine triphosphate | Guanosine diphosphate | Adenylosuccinate synthetase | Synthesis | RHEA | 34755880 |
| MMDBr0013466 | Water | Hydrogen peroxide | Probable pyridoxamine 5'-phosphate oxidase | Oxidation | RHEA | 34755880 |
| MMDBr0013470 | (2R)-2-phosphoglyceric acid | (2R)-3-phosphoglyceric acid | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
| MMDBr0013475 | Water | Acetic acid | N-acetyl-L-citrulline deacetylase | Deacetylase | RHEA | 34755880 |
| MMDBr0013478 | Hydrogen Ion | Carbon dioxide | S-adenosylmethionine decarboxylase proenzyme | Decarboxylation | RHEA | 34755880 |
| MMDBr0013488 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013489 | adenosylcob(III)inamide-GDP | coenzyme B12 | Adenosylcobinamide-GDP ribazoletransferase | Ribazoletransferase | RHEA | 34755880 |
| MMDBr0013493 | Cytidine | Ammonium | Cytidine deaminase | Deamination | RHEA | 34755880 |
| MMDBr0013495 | Adenosine triphosphate | ADP | ATP-dependent 6-phosphofructokinase | Phosphofructokinase | RHEA | 34755880 |
| MMDBr0013526 | Pantothenic acid | (R)-4'-phosphopantothenic acid | Bifunctional enzyme BirA/CoaX | Phosphorylation | RHEA | 34755880 |
| MMDBr0013536 | Chorismate | 4-Hydroxybenzoic acid | Chorismate pyruvate-lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0013542 | Formyl-CoA | formate | Formyl-CoA:oxalate CoA-transferase | Transfer of CoA moiety | RHEA | 34755880 |
| MMDBr0013544 | alpha-Ketoglutarate | (R)-3-hydroxy-2-oxo-4-phosphooxybutanoic acid | Phosphoserine aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0013547 | Adenosine triphosphate | ADP | CTP synthase | Synthesis | RHEA | 34755880 |
| MMDBr0013549 | Adenosine monophosphate | Phosphoribosyl pyrophosphate | Adenine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013564 | Adenosine triphosphate | ADP | Potassium-transporting ATPase ATP-binding subunit | ATP hydrolysis | RHEA | 34755880 |
| MMDBr0013565 | Adenosine triphosphate | ADP | Potassium-transporting ATPase ATP-binding subunit | ATP hydrolysis | RHEA | 34755880 |
| MMDBr0013584 | Hydrogen cyanide | Hydrogen Ion | Thiosulfate sulfurtransferase GlpE | Sulfuration | RHEA | 34755880 |
| MMDBr0013590 | alpha-Ketoglutarate | L-Glutamic acid | Succinylornithine transaminase/acetylornithine aminotransferase | Amine group addition; Transaminase | RHEA | 34755880 |
| MMDBr0013607 | (S)(+)-Allantoin | Allantoic acid | Allantoinase | Allantoinase | RHEA | 34755880 |
| MMDBr0013627 | Inosinic acid | GMP | GMP reductase | Reduction | RHEA | 34755880 |
| MMDBr0013632 | L-Fucose | L-Fuculose | L-fucose isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0013642 | (S)-2,3,4,5-tetrahydrodipicolinate | (S)-2-succinylamino-6-oxoheptanedioic acid | 2,3,4,5-tetrahydropyridine-2,6-dicarboxylate N-succinyltransferase | Succinyltransferase | RHEA | 34755880 |
| MMDBr0013652 | Adenosine triphosphate | ADP | N-acetylgalactosamine kinase AgaK | Phosphorylation | RHEA | 34755880 |
| MMDBr0013659 | Guanosine triphosphate | 7,8-dihydroneopterin 3'-triphosphate | Bifunctional protein FolKE | Cyclohydrolase | RHEA | 34755880 |
| MMDBr0013664 | ADP-D-glycero-beta-D-manno-heptose | ADP-L-glycero-beta-D-manno-heptose | ADP-L-glycero-D-manno-heptose-6-epimerase | Epimerization | RHEA | 34755880 |
| MMDBr0013674 | Adenosine triphosphate | ADP | Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial | Ligation | RHEA | 34755880 |
| MMDBr0013681 | NADP(+) | 3-Dehydroshikimic acid | Pentafunctional AROM polypeptide | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013682 | NAD | 3-Dehydroshikimic acid | Quinate/shikimate dehydrogenase (NAD(+)) | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013683 | S-Ribosyl-L-homocysteine | (4S)-4,5-Dihydroxypentan-2,3-dione | S-ribosylhomocysteine lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0013686 | Water | Adenine | Aminodeoxyfutalosine nucleosidase | Nucleosidase | RHEA | 34755880 |
| MMDBr0013690 | Adenosine triphosphate | ADP | Putative glucokinase-2 | Glucokinase; Glucomannokinase; Hexokinase; Phosphorylation | RHEA | 34755880 |
| MMDBr0013699 | Glyceric acid | 3-hydroxypyruvic acid | Glycerate dehydrogenase | Dehydrogenation; Reduction | RHEA | 34755880 |
| MMDBr0013703 | Dihydroxyacetone phosphate | BPG | Methylglyoxal synthase | Synthesis | RHEA | 34755880 |
| MMDBr0013708 | diphosphate | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013709 | Phosphoribosyl pyrophosphate | diphosphate | Hypoxanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013729 | Adenosine triphosphate | Adenosine phosphosulfate | Sulfate adenylyltransferase subunit 2 | Adenylyltransferase; Phosphorylation | RHEA | 34755880 |
| MMDBr0013745 | Coproporphyrinogen III | Carbon dioxide | Oxygen-dependent coproporphyrinogen-III oxidase | Oxidation | RHEA | 34755880 |
| MMDBr0013767 | Quinate | 3-Dehydroquinate | Quinate/shikimate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013768 | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013770 | Water | Phosphoribosyl formamidocarboxamide | Bifunctional purine biosynthesis protein PurH | Cyclohydrolase | RHEA | 34755880 |
| MMDBr0013771 | D-Ribulose 5-phosphate | L-3,4-Dihydroxybutan-2-one 4-phosphate | 3,4-dihydroxy-2-butanone 4-phosphate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0013773 | 1-(5-phosphoribosyl)-ATP | Phosphoribosyl pyrophosphate | ATP phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0013774 | L-Ribulose 5-phosphate | L-Xylulose 5-phosphate | Putative L-ribulose-5-phosphate 3-epimerase SgbU | Epimerization | RHEA | 34755880 |
| MMDBr0013784 | D-Glyceraldehyde 3-phosphate | Dihydroxyacetone phosphate | Bifunctional PGK/TIM | Isomerization | RHEA | 34755880 |
| MMDBr0013790 | Adenosine triphosphate | ADP | Phosphoenolpyruvate carboxykinase (ATP) | Carboxykinase | RHEA | 34755880 |
| MMDBr0013792 | Adenosine triphosphate | ADP | NAD kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0013796 | D-Galactonate | 2-Keto-3-deoxy-D-gluconic acid | L-arabinonate dehydratase | Dehydratase | RHEA | 34755880 |
| MMDBr0013798 | Glyceric acid | 3-hydroxypyruvic acid | Glyoxylate/hydroxypyruvate reductase A | Reduction | RHEA | 34755880 |
| MMDBr0013809 | Ribose-1-phosphate | D-Ribose-5-phosphate | Phosphopentomutase | Phosphopentomutase; Phosphoribomutase | RHEA | 34755880 |
| MMDBr0013811 | 4-Phospho-D-erythronate | (R)-3-hydroxy-2-oxo-4-phosphooxybutanoic acid | Erythronate-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013819 | aldehydo-D-glucose 6-phosphate | alpha,alpha-Trehalose 6-phosphate | Trehalose-6-phosphate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0013841 | 4-Aminobutyraldehyde | gamma-Aminobutyric acid | Gamma-aminobutyraldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013842 | 4-Aminobutyraldehyde | gamma-Aminobutyric acid | Gamma-aminobutyraldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013852 | 2-O-(alpha-D-mannosyl)-3-phosphoglyceric acid | (2R)-2-O-(alpha-D-mannosyl)-glyceric acid | Glucosyl-3-phosphoglycerate phosphatase | Dephosphorylation | RHEA | 34755880 |
| MMDBr0013884 | Hydrogen Ion | beta-Alanine | L-aspartate decarboxylase dtxS4 | Decarboxylation | RHEA | 34755880 |
| MMDBr0013892 | Hydrogen Ion | Carbon dioxide | N-succinylarginine dihydrolase | Dihydrolase | RHEA | 34755880 |
| MMDBr0013895 | L-Glutamic-gamma-semialdehyde | Hydrogen Ion | Gamma-glutamyl phosphate reductase | Reduction | RHEA | 34755880 |
| MMDBr0013906 | Mannitol 1-phosphate | beta-D-Fructose 6-phosphate | Mannitol-1-phosphate 5-dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0013908 | Guanosine triphosphate | Guanosine diphosphate | GTPase ArgK | Dephosphorylation; GTP hydrolysis; Intramolecular transfer of functional group; Nucleic acid synthesis and/or repair; Phytase | RHEA | 34755880 |
| MMDBr0013910 | L-Rhamnulose 1-phosphate | Limonene | Rhamnulose-1-phosphate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
| MMDBr0013921 | (R)-4'-phosphopantetheine | 3'-dephospho-CoA | Phosphopantetheine adenylyltransferase | Adenylyltransferase | RHEA | 34755880 |
| MMDBr0013929 | Hydrogen Ion | Carbon dioxide | Uroporphyrinogen decarboxylase | Decarboxylation | RHEA | 34755880 |
| MMDBr0013946 | Carbamoylphosphate | Hydrogen Ion | Protein pyrABCN | Carbamoyltransferase | RHEA | 34755880 |
| MMDBr0013960 | Adenosine triphosphate | ADP | Bifunctional enzyme RhaA/RhaB | Rhamnulokinase | RHEA | 34755880 |
| MMDBr0013978 | Hydrogen peroxide | Water | Bromoperoxidase-catalase | Catalase; Dimerase; Peroxidation; Synthesis | RHEA | 34755880 |
| MMDBr0013982 | 3-phenylpropanoic acid | Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol | 3-phenylpropionate/cinnamic acid dioxygenase subunit alpha | Oxygenation | RHEA | 34755880 |
| MMDBr0014061 | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Chorismate | Chorismate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014068 | 3-Dehydroquinate | 3-Dehydroshikimic acid | Catabolic 3-dehydroquinase | Dehydratase; Dehydroquinase | RHEA | 34755880 |
| MMDBr0014080 | Adenosine triphosphate | Adenosine monophosphate | NH(3)-dependent NAD(+) synthetase | Synthesis | RHEA | 34755880 |
| MMDBr0014083 | Shikimate 3-phosphate | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | Pentafunctional AROM polypeptide | Carboxyvinyltransferase | RHEA | 34755880 |
| MMDBr0014105 | (S)-malate(2-) | Hydrogen Ion | Malate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0014113 | Polyphosphate | Polyphosphate | Endopolyphosphatase | Endopolyphosphatase; Exopolyphosphatase; Hydrolysis of nucleotide; Polyphosphatase | RHEA | 34755880 |
| MMDBr0014122 | FMNH2 | Flavin mononucleotide | NAD(P)H-dependent FMN reductase atnL | Reduction | RHEA | 34755880 |
| MMDBr0014126 | Adenosine triphosphate | ADP | Glycerol kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014141 | (S)-3-Hydroxybutanoyl-CoA | (3R)-3-hydroxybutanoyl-CoA | Fatty acid oxidation complex subunit alpha | | RHEA | 34755880 |
| MMDBr0014154 | 3-Dehydro-L-gulonate | 2,3-Diketo-L-gulonate | 2,3-diketo-L-gulonate reductase | Reduction | RHEA | 34755880 |
| MMDBr0014155 | 3-Dehydro-L-gulonate | 2,3-Diketo-L-gulonate | 2,3-diketo-L-gulonate reductase | Reduction | RHEA | 34755880 |
| MMDBr0014160 | 3-deoxy-D-arabino-heptulosonate-7-phosphate | 3-Dehydroquinate | Pentafunctional AROM polypeptide | Phosphorylation; Synthesis | RHEA | 34755880 |
| MMDBr0014164 | L-Homoserine | CoA | Homoserine O-succinyltransferase | Succinyltransferase | RHEA | 34755880 |
| MMDBr0014167 | (R)-2,3-Dihydroxy-isovalerate | (2S)-2-acetolactic acid | Ketol-acid reductoisomerase, mitochondrial | Reductoisomerase | RHEA | 34755880 |
| MMDBr0014180 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional purine biosynthesis protein PurH | | RHEA | 34755880 |
| MMDBr0014197 | Quinate | 3-Dehydroquinate | Quinate/shikimate dehydrogenase (NAD(+)) | Dehydrogenation | RHEA | 34755880 |
| MMDBr0014198 | L-Ribulose 5-phosphate | Xylulose 5-phosphate | L-ribulose-5-phosphate 4-epimerase | Epimerization | RHEA | 34755880 |
| MMDBr0014221 | Hydrogen Ion | Fe2+ | Deferrochelatase/peroxidase EfeB | Ferrochelatase; Peroxidation | RHEA | 34755880 |
| MMDBr0014225 | Water | LL-2,6-Diaminoheptanedioate | Succinyl-diaminopimelate desuccinylase | Desuccinylase | RHEA | 34755880 |
| MMDBr0014229 | 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate | (2S)-2-[5-Amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamido]succinic acid | Phosphoribosylaminoimidazole-succinocarboxamide synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014231 | dCTP | dCMP | CTP pyrophosphohydrolase | Dephosphorylation; Pyrophosphatase; Pyrophosphohydrolase | RHEA | 34755880 |
| MMDBr0014234 | 2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-alpha-D-glucosaminyl 1-phosphate | Hydrogen Ion | Lipid-A-disaccharide synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014236 | dCTP | Deoxyuridine triphosphate | dCTP deaminase | Deamination | RHEA | 34755880 |
| MMDBr0014251 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | 5,10-Methenyltetrahydrofolate | C-1-tetrahydrofolate synthase, cytoplasmic | Synthesis | RHEA | 34755880 |
| MMDBr0014254 | D-Xylose | D-Xylulose | Xylose isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014276 | D-Tagatose 1,6-bisphosphate | D-Glyceraldehyde 3-phosphate | D-tagatose-1,6-bisphosphate aldolase subunit GatY | Aldol addition (or reverse) | RHEA | 34755880 |
| MMDBr0014282 | 2-formamido-N(1)-(5-O-phospho-beta-D-ribosyl)acetamidine | 5-Aminoimidazole ribonucleotide | Bifunctional purine biosynthetic protein ADE5,7 | Ligation | RHEA | 34755880 |
| MMDBr0014285 | L-Rhamnonate | 2-Dehydro-3-deoxy-L-rhamnonate | L-rhamnonate dehydratase | Dehydratase | RHEA | 34755880 |
| MMDBr0014298 | Rhamnose | L-Rhamnulose | L-rhamnose isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014311 | Isopentenyl pyrophosphate | Dimethylallylpyrophosphate | Isopentenyl-diphosphate Delta-isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014316 | N-acetylneuraminate | N-acetyl-D-mannosamine | N-acetylneuraminate lyase | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0014323 | Adenosine triphosphate | ADP | Bifunctional enzyme MurC/Ddl | Ligation | RHEA | 34755880 |
| MMDBr0014333 | alpha-D-Glucosamine 1-phosphate | D-glucosamine 6-phosphate | Phosphoglucosamine mutase | Intramolecular transfer of functional group | RHEA | 34755880 |
| MMDBr0014337 | 3-deoxy-D-manno-2-octulosonate | CMP-3-deoxy-beta-D-manno-octulosonate | 3-deoxy-manno-octulosonate cytidylyltransferase | Cytidylyltransferase | RHEA | 34755880 |
| MMDBr0014353 | adenosylcob(III)inamide-GDP | adenosylcob(III)alamin 5'-phosphate | Adenosylcobinamide-GDP ribazoletransferase | Ribazoletransferase | RHEA | 34755880 |
| MMDBr0014367 | Adenine | Hypoxanthine | Adenine deaminase | Deamination | RHEA | 34755880 |
| MMDBr0014369 | 5,10-Methenyltetrahydrofolate | (6S)-10-formyltetrahydrofolic acid | C-1-tetrahydrofolate synthase, cytoplasmic | Cyclohydrolase; Synthesis | RHEA | 34755880 |
| MMDBr0014377 | alpha-Ketoglutarate | 3-(Imidazol-4-yl)-2-oxopropyl phosphate | Histidinol-phosphate aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0014387 | 3-(2,3-Dihydroxyphenyl)propanoate | 2-Hydroxy-6-ketononadienedicarboxylate | 2,3-dihydroxyphenylpropionate/2,3-dihydroxicinnamic acid 1,2-dioxygenase | Oxygenation | RHEA | 34755880 |
| MMDBr0014392 | 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | Bifunctional enzyme IspD/IspF | Synthesis | RHEA | 34755880 |
| MMDBr0014393 | 5-Dehydro-4-deoxy-D-glucuronate | (4S)-4,6-Dihydroxy-2,5-dioxohexanoate | 4-deoxy-L-threo-5-hexosulose-uronate ketol-isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014407 | Argininosuccinic acid | fumarate | Bifunctional protein ArgHA | Non-hydrolytic bond cleavage (or its reversal) | RHEA | 34755880 |
| MMDBr0014417 | Adenosine phosphosulfate | Phosphoadenosine phosphosulfate | Adenylyl-sulfate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014426 | 4-Methyl-5-(2-hydroxyethyl)-thiazole | 4-methyl-5-(2-phosphooxyethyl)-thiazole | Probable thiamine biosynthetic bifunctional enzyme | Phosphorylation | RHEA | 34755880 |
| MMDBr0014431 | Water | ADP | Bis(5'-nucleosyl)-tetraphosphatase, symmetrical | Dephosphorylation; Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0014437 | L-Dihydroorotic acid | Hydrogen Ion | Dihydroorotase | Dihydroorotase | RHEA | 34755880 |
| MMDBr0014442 | Hydrogen Ion | Fe2+ | Sirohydrochlorin cobaltochelatase CbiKC | Cobaltochelatase; Ferrochelatase; Synthesis | RHEA | 34755880 |
| MMDBr0014444 | Phosphate | Ribose-1-phosphate | Pyrimidine-nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014449 | Deoxyadenosine | Inosine | Adenosine deaminase | Deamination; Phosphorylation | RHEA | 34755880 |
| MMDBr0014450 | Deoxyadenosine | Inosine | Adenosine deaminase | Deamination; Phosphorylation | RHEA | 34755880 |
| MMDBr0014477 | NAD | Carbon dioxide | Bifunctional polymyxin resistance protein ArnA | | RHEA | 34755880 |
| MMDBr0014479 | (6S)-10-formyltetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Bifunctional polymyxin resistance protein ArnA | | RHEA | 34755880 |
| MMDBr0014481 | alpha-Ketoglutarate | L-Glutamic acid | UDP-4-amino-4-deoxy-L-arabinose--oxoglutarate aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0014484 | 3-(3-Hydroxyphenyl)propionate | 3-(2,3-Dihydroxyphenyl)propanoate | 3-(3-hydroxy-phenyl)propionate/3-hydroxycinnamic acid hydroxylase | Hydroxylation | RHEA | 34755880 |
| MMDBr0014489 | Adenosine triphosphate | ADP | Formate-dependent phosphoribosylglycinamide formyltransferase | Formyltransferase | RHEA | 34755880 |
| MMDBr0014490 | Adenosine triphosphate | ADP | Formate-dependent phosphoribosylglycinamide formyltransferase | Formyltransferase | RHEA | 34755880 |
| MMDBr0014502 | 1,6-Anhydro-N-acetyl-beta-muramate | ADP | Anhydro-N-acetylmuramic acid kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014509 | (2E)-3-(2,3-dihydroxyphenyl)prop-2-enoic acid | δ7-Avenasterol | 2,3-dihydroxyphenylpropionate/2,3-dihydroxicinnamic acid 1,2-dioxygenase | Oxygenation | RHEA | 34755880 |
| MMDBr0014510 | trans-Cinnamic acid | cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol | 3-phenylpropionate/cinnamic acid dioxygenase subunit alpha | Oxygenation | RHEA | 34755880 |
| MMDBr0014511 | Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol | 3-(2,3-Dihydroxyphenyl)propanoate | 3-phenylpropionate-dihydrodiol/cinnamic acid-dihydrodiol dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0014512 | cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol | (2E)-3-(2,3-dihydroxyphenyl)prop-2-enoic acid | 3-phenylpropionate-dihydrodiol/cinnamic acid-dihydrodiol dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0014514 | Adenosine triphosphate | ADP | Cytidylate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014515 | Adenosine triphosphate | ADP | Pyridoxine/pyridoxal/pyridoxamine kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014516 | Adenosine triphosphate | ADP | Pyridoxine/pyridoxal/pyridoxamine kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014523 | Water | 2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-alpha-D-glucosaminyl 1-phosphate | UDP-2,3-diacylglucosamine hydrolase | Hydrolysis of bond; Pyrophosphatase | RHEA | 34755880 |
| MMDBr0014556 | diphosphate | Phosphoribosyl pyrophosphate | Hypoxanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0014557 | Phosphoribosyl pyrophosphate | diphosphate | Hypoxanthine-guanine phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0014559 | beta-D-Ribopyranose | beta-D-ribofuranose | L-fucose mutarotase | Mutarotation; Pyranase | RHEA | 34755880 |
| MMDBr0014565 | alpha-L-Rhamnose | beta-L-Rhamnose | L-rhamnose mutarotase | Mutarotation | RHEA | 34755880 |
| MMDBr0014566 | alpha-Ketoglutarate | 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylic acid | 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014567 | 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylic acid | (1R,6R)-6-Hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate | Putative 2-succinyl-6-hydroxy-2,4-cyclohexadiene-1-carboxylate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014579 | 2-Dehydro-3-deoxy-L-rhamnonate | Limonene | 2-keto-3-deoxy-L-rhamnonate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
| MMDBr0014596 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014597 | Dihydroxyacetone phosphate | Hydrogen Ion | Quinolinate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014619 | L-3,4-Dihydroxybutan-2-one 4-phosphate | 6,7-Dimethyl-8-(1-D-ribityl)lumazine | 6,7-dimethyl-8-ribityllumazine synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014642 | Water | D-Lactic acid | N-acetylmuramic acid 6-phosphate etherase | Etherase | RHEA | 34755880 |
| MMDBr0014644 | 3-hydroxypropanoic acid | Malonic semialdehyde | Probable malonic semialdehyde reductase RutE | Dehydrogenation; Reduction | RHEA | 34755880 |
| MMDBr0014685 | Water | Acetic acid | Chitooligosaccharide deacetylase | Deacetylase | RHEA | 34755880 |
| MMDBr0014686 | Adenosine triphosphate | ADP | D-beta-D-heptose 7-phosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014688 | D-Sedoheptulose 7-phosphate | D-glycero-alpha-D-manno-heptose 7-phosphate | Phosphoheptose isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014707 | Phosphate | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
| MMDBr0014708 | Deoxyadenosine | Adenine | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
| MMDBr0014710 | Inosine | Ribose-1-phosphate | Purine nucleoside phosphorylase DeoD-type | Deamination; Phosphorylation | RHEA | 34755880 |
| MMDBr0014720 | D-Galacturonate | D-Tagaturonate | Uronate isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0014725 | di-trans,octa-cis-undecaprenyl phosphate | 4-deoxy-4-formamido-alpha-L-arabinopyranosyl di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-phosphate 4-deoxy-4-formamido-L-arabinose transferase | Undecaprenyl-phosphate 4-deoxy-4-formamido-L-arabinose transferase | RHEA | 34755880 |
| MMDBr0014726 | 5-Dehydro-4-deoxy-D-glucarate | 2-Hydroxy-3-oxopropanoate | 5-keto-4-deoxy-D-glucarate aldolase | Aldol addition (or reverse) | RHEA | 34755880 |
| MMDBr0014727 | 4-deoxy-4-formamido-alpha-L-arabinopyranosyl di-trans,octa-cis-undecaprenyl phosphate | 4-Amino-4-deoxy-alpha-L-arabinopyranosyl di-trans,octa-cis-undecaprenyl phosphate | Probable 4-deoxy-4-formamido-L-arabinose-phosphoundecaprenol deformylase ArnD | Deformylase | RHEA | 34755880 |
| MMDBr0014732 | 4-Hydroxybenzoic acid | 3-Octaprenyl-4-hydroxybenzoate | 4-hydroxybenzoate octaprenyltransferase | Octaprenyltransferase | RHEA | 34755880 |
| MMDBr0014742 | 3-Hydroxycinnamic acid | (2E)-3-(2,3-dihydroxyphenyl)prop-2-enoic acid | 3-(3-hydroxy-phenyl)propionate/3-hydroxycinnamic acid hydroxylase | Hydroxylation | RHEA | 34755880 |
| MMDBr0014751 | 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate | 4-Amino-2-methyl-5-phosphomethylpyrimidine | HMP-PP phosphatase | Dephosphorylation | RHEA | 34755880 |
| MMDBr0014762 | Guanosine diphosphate mannose | alpha-D-mannose 1-phosphate | GDP-mannose pyrophosphatase | Pyrophosphatase | RHEA | 34755880 |
| MMDBr0014763 | 7-Deaza-7-carboxyguanine | 7-Cyano-7-carbaguanine | 7-cyano-7-deazaguanine synthase | Synthesis | RHEA | 34755880 |
| MMDBr0014776 | Farnesyl pyrophosphate | diphosphate | Protoheme IX farnesyltransferase, mitochondrial | Farnesyltransferase | RHEA | 34755880 |
| MMDBr0014783 | di-trans,octa-cis-undecaprenyl diphosphate | di-trans,octa-cis-undecaprenyl phosphate | Undecaprenyl-diphosphatase BcrC | Dephosphorylation; Phosphatidylglycerophosphatase | RHEA | 34755880 |
| MMDBr0014813 | Water | Hydrogen Ion | Bifunctional phosphopantetheine adenylyltransferase/NTP phosphatase | Adenylyltransferase; Dephosphorylation | RHEA | 34755880 |
| MMDBr0014820 | N-acetyl-alpha-D-glucosaminyl-di-trans,octa-cis-undecaprenyl diphosphate | beta-D-ManNAcA-(1->4)-alpha-D-GlcNAc-di-trans,octa-cis-undecaprenyl diphosphate | UDP-N-acetyl-D-mannosaminuronic acid transferase | UDP-N-acetyl-D-mannosaminuronic acid transferase | RHEA | 34755880 |
| MMDBr0014821 | Oxalacetic acid | Hydrogen carbonate | Phosphoenolpyruvate carboxylase | Carboxylation | RHEA | 34755880 |
| MMDBr0014825 | di-trans,octa-cis-undecaprenyl phosphate | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | Phospho-N-acetylmuramoyl-pentapeptide-transferase | Transferase | RHEA | 34755880 |
| MMDBr0014829 | Water | Hydrogen Ion | Bifunctional phosphopantetheine adenylyltransferase/NTP phosphatase | Adenylyltransferase; Dephosphorylation | RHEA | 34755880 |
| MMDBr0014832 | (R)-Carnitine | (R)-carnitinyl-CoA | L-carnitine CoA-transferase | Transfer of CoA moiety | RHEA | 34755880 |
| MMDBr0014843 | (R)-Carnitine | (R)-carnitinyl-CoA | Crotonobetaine/carnitine--CoA ligase | Ligation | RHEA | 34755880 |
| MMDBr0014844 | (R)-Carnitine | (R)-carnitinyl-CoA | L-carnitine CoA-transferase | Transfer of CoA moiety | RHEA | 34755880 |
| MMDBr0014846 | Thymidine 5'-triphosphate | diphosphate | dTTP/UTP pyrophosphatase | Dephosphorylation; Pyrophosphatase | RHEA | 34755880 |
| MMDBr0014855 | beta-D-ManNAcA-(1->4)-alpha-D-GlcNAc-di-trans,octa-cis-undecaprenyl diphosphate | Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose | TDP-N-acetylfucosamine:lipid II N-acetylfucosaminyltransferase | | RHEA | 34755880 |
| MMDBr0014858 | Water | 3-Dehydro-L-gulonate 6-phosphate | Probable L-ascorbate-6-phosphate lactonase UlaG | Lactonase | RHEA | 34755880 |
| MMDBr0014897 | Hydrogen Ion | Hydrogen Ion | Na(+)/H(+) antiporter NhaB | | RHEA | 34755880 |
| MMDBr0014898 | Hydrogen Ion | Hydrogen Ion | Na(+)/H(+) antiporter NhaB | | RHEA | 34755880 |
| MMDBr0014911 | (R)-Carnitine | (R)-Carnitine | L-carnitine/gamma-butyrobetaine antiporter | | RHEA | 34755880 |
| MMDBr0014918 | Hydrogen Ion | Hydrogen Ion | K(+)/H(+) antiporter NhaP2 | | RHEA | 34755880 |
| MMDBr0014919 | Hydrogen Ion | Hydrogen Ion | K(+)/H(+) antiporter NhaP2 | | RHEA | 34755880 |
| MMDBr0014921 | Chloride ion | Chloride ion | H(+)/Cl(-) exchange transporter ClcA | | RHEA | 34755880 |
| MMDBr0014941 | 5'-Deoxyadenosine | 5'-Deoxyribose | Aminodeoxyfutalosine nucleosidase | Nucleosidase | RHEA | 34755880 |
| MMDBr0014942 | 5'-Deoxyadenosine | 5'-Deoxyribose | 5'-methylthioadenosine/S-adenosylhomocysteine nucleosidase | Nucleosidase | RHEA | 34755880 |
| MMDBr0014961 | Adenosine triphosphate | Adenosine monophosphate | Crotonobetaine/carnitine--CoA ligase | Ligation | RHEA | 34755880 |
| MMDBr0015026 | di-trans-octa-cis-undecaprenyl diphospho-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | di-trans-octa-cis-undecaprenyl diphospho-[N-acetyl-alpha-D-glucosaminyl-(1->4)]-N-acetyl-alpha-D-muramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase | UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 1; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 2; UDP-N-acetylglucosamine--N-acetylmuramyl-(pentapeptide) pyrophosphoryl-undecaprenol N-acetylglucosamine transferase 3 | RHEA | 34755880 |
| MMDBr0015055 | FMNH2 | (Z)-3-Ureidoacrylate | Pyrimidine monooxygenase RutA | Oxygenation | RHEA | 34755880 |
| MMDBr0015056 | FMNH2 | (Z)-2-methylureidoacrylic acid | Pyrimidine monooxygenase RutA | Oxygenation | RHEA | 34755880 |
| MMDBr0015057 | (Z)-3-Ureidoacrylate | 3-Aminoacrylate | Ureidoacrylate amidohydrolase RutB | Amidohydrolase | RHEA | 34755880 |
| MMDBr0015135 | 4-(phosphooxy)-L-threonine | 3-Amino-2-oxopropyl phosphate | 4-hydroxythreonine-4-phosphate dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0015149 | S-Adenosylmethionine | Hydrogen Ion | Siroheme synthase | Methylation; Synthesis | RHEA | 34755880 |
| MMDBr0015318 | 2-Hydroxy-6-ketononadienedicarboxylate | (2Z)-2-hydroxypenta-2,4-dienoate | 2-hydroxy-6-oxononadienedioate/2-hydroxy-6-oxononatrienedioate hydrolase | Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0015319 | δ7-Avenasterol | (2Z)-2-hydroxypenta-2,4-dienoate | 2-hydroxy-6-oxononadienedioate/2-hydroxy-6-oxononatrienedioate hydrolase | Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0015384 | 3-Aminoacrylate | Malonic semialdehyde | Putative aminoacrylate peracid reductase RutC | Reduction | RHEA | 34755880 |
| MMDBr0015391 | Diacetylchitobiose-6-phosphate | Acetic acid | Chitooligosaccharide deacetylase | Deacetylase | RHEA | 34755880 |
| MMDBr0015402 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
| MMDBr0015405 | (S)-2,3,4,5-tetrahydrodipicolinate | (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate | 4-hydroxy-tetrahydrodipicolinate reductase | Reduction | RHEA | 34755880 |
| MMDBr0015480 | Phosphoribosyl pyrophosphate | ADP | Probable nicotinate phosphoribosyltransferase | Phosphoribosyltransferase | RHEA | 34755880 |
| MMDBr0015860 | (Z)-2-methylureidoacrylic acid | (Z)-2-methylaminoacrylic acid | Ureidoacrylate amidohydrolase RutB | Amidohydrolase | RHEA | 34755880 |
| MMDBr0015861 | (Z)-3-Ureidoacrylate | 3-Aminoacrylate | Ureidoacrylate amidohydrolase RutB | Amidohydrolase | RHEA | 34755880 |
| MMDBr0015880 | Hydrogen Ion | NADH | Nitric oxide reductase FlRd-NAD(+) reductase | Reduction | RHEA | 34755880 |
| MMDBr0015916 | 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate | 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (flavodoxin) | Synthesis | RHEA | 34755880 |
| MMDBr0016079 | (2S)-2-hydroxy-3,4-dioxopentyl phosphate | 3-hydroxy-2,4-pentanedione 5-phosphate | (4S)-4-hydroxy-5-phosphonooxypentane-2,3-dione isomerase | Isomerization | RHEA | 34755880 |
| MMDBr0016097 | Acetyl-CoA | 3-hydroxy-2,4-pentanedione 5-phosphate | 3-hydroxy-5-phosphonooxypentane-2,4-dione thiolase | Thiolase | RHEA | 34755880 |
| MMDBr0016398 | Fe2+ | Iron(3+) | DNA protection during starvation protein | | RHEA | 34755880 |
| MMDBr0016411 | Water | Adenosine monophosphate | NAD-capped RNA hydrolase | Hydrolysis of bond | RHEA | 34755880 |
| MMDBr0016462 | (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate | Cyclic pyranopterin monophosphate | Cyclic pyranopterin monophosphate synthase | Synthesis | RHEA | 34755880 |
| MMDBr0016554 | gamma-Butyrobetainyl-CoA | Crotonobetainyl-CoA | Crotonobetainyl-CoA reductase | Reduction | RHEA | 34755880 |
| MMDBr0016558 | D-5-phenylhydantoin | Hydrogen Ion | D-phenylhydantoinase | Phenylhydantoinase | RHEA | 34755880 |
| MMDBr0016600 | Cytidine | Ribose-1-phosphate | Pyrimidine/purine nucleoside phosphorylase | Phosphorylation | RHEA | 34755880 |
| MMDBr0016815 | 4-Trimethylammoniobutanoic acid | Adenosine monophosphate | Crotonobetaine/carnitine--CoA ligase | Ligation | RHEA | 34755880 |
| MMDBr0016872 | Water | dGTP | Protein/nucleic acid deglycase HchA | Deglycase | RHEA | 34755880 |
| MMDBr0016873 | Water | dGTP | Protein/nucleic acid deglycase HchA | Deglycase | RHEA | 34755880 |
| MMDBr0016874 | Water | Glycolic acid | Protein/nucleic acid deglycase HchA | Deglycase | RHEA | 34755880 |
| MMDBr0016875 | Water | Guanosine triphosphate | Protein/nucleic acid deglycase HchA | Deglycase | RHEA | 34755880 |
| MMDBr0016876 | Water | Guanosine diphosphate | Protein/nucleic acid deglycase HchA | Deglycase | RHEA | 34755880 |
| MMDBr0016877 | Water | Guanosine diphosphate | Protein/nucleic acid deglycase HchA | Deglycase | RHEA | 34755880 |
| MMDBr0016878 | Water | GMP | Protein/nucleic acid deglycase HchA | Deglycase | RHEA | 34755880 |
| MMDBr0016879 | Water | Glycolic acid | Protein/nucleic acid deglycase HchA | Deglycase | RHEA | 34755880 |
| MMDBr0016907 | Adenosine triphosphate | ADP | ATP synthase subunit alpha | ATP hydrolysis; Synthesis | RHEA | 34755880 |
| MMDBr0017136 | alpha-Ketoglutarate | 5-Aminopentanal | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0017137 | alpha-Ketoglutarate | 5-Aminopentanal | Putrescine aminotransferase | Amine group addition | RHEA | 34755880 |
| MMDBr0017138 | 5-Aminopentanal | 5-Aminopentanoic acid | Gamma-aminobutyraldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0017139 | 5-Aminopentanal | 5-Aminopentanoic acid | Gamma-aminobutyraldehyde dehydrogenase | Dehydrogenation | RHEA | 34755880 |
| MMDBr0017322 | Water | Acetic acid | N(4)-acetylcytidine amidohydrolase | Amidohydrolase | RHEA | 34755880 |
| MMDBr0017323 | Water | Deoxycytidine | N(4)-acetylcytidine amidohydrolase | Amidohydrolase | RHEA | 34755880 |
| MMDBr0017324 | Water | Acetic acid | N(4)-acetylcytidine amidohydrolase | Amidohydrolase | RHEA | 34755880 |
| MMDBr0017834 | (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate | D-Glyceraldehyde 3-phosphate | Tryptophan synthase | | RHEA | 34755880 |
| MMDBr0017839 | Adenosine triphosphate | Adenosine monophosphate | Aspartate--ammonia ligase | | RHEA | 34755880 |
| MMDBr0017843 | Adenosine triphosphate | Adenosine monophosphate | GMP synthase [glutamine-hydrolyzing] | | RHEA | 34755880 |
| MMDBr0017850 | L-Threonine | L-2-Amino-3-oxobutanoic acid | L-threonine 3-dehydrogenase | | RHEA | 34755880 |
| MMDBr0017852 | Adenosine triphosphate | ADP | Glutamate--cysteine ligase EgtA | | RHEA | 34755880 |
| MMDBr0017871 | (6R)-5,10-methylene-5,6,7,8-tetrahydrofolic acid | (6S)-5,6,7,8-tetrahydrofolic acid | Serine hydroxymethyltransferase | | RHEA | 34755880 |
| MMDBr0017874 | Water | L-Glutamic acid | Thermolabile glutaminase | | RHEA | 34755880 |
| MMDBr0017886 | Water | Indole | Probable tryptophanase | | RHEA | 34755880 |
| MMDBr0017897 | Adenosine triphosphate | diphosphate | S-adenosylmethionine synthase | | RHEA | 34755880 |
| MMDBr0017898 | 5-methyltetrahydropteroyltri-L-glutamate | L-Methionine | 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase | | RHEA | 34755880 |
| MMDBr0017916 | 5-[(5-phospho-1-deoxy-D-ribulos-1-ylimino)methylamino]-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide | AICAR | Imidazole glycerol phosphate synthase subunit HisH | | RHEA | 34755880 |
| MMDBr0017917 | 5-Aminoimidazole ribonucleotide | 4-Amino-2-methyl-5-phosphomethylpyrimidine | Phosphomethylpyrimidine synthase | | RHEA | 34755880 |
| MMDBr0017926 | Adenosine triphosphate | ADP | CTP synthase | | RHEA | 34755880 |
| MMDBr0017930 | Water | Formaldehyde | N-methyl-L-tryptophan oxidase | | RHEA | 34755880 |
| MMDBr0017965 | Adenosine triphosphate | diphosphate | Threonylcarbamoyl-AMP synthase | | RHEA | 34755880 |
| MMDBr0017981 | Prephenate | 3-phenylpyruvic acid | Carboxy-S-adenosyl-L-methionine synthase | | RHEA | 34755880 |
| MMDBr0024345 | Adenosine triphosphate | Hydrogen Ion | Tyrosine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024368 | Adenosine triphosphate | diphosphate | Isoleucine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024386 | Selenocysteine | Hydrogen Ion | Cysteine desulfurase | | RHEA | 34755880 |
| MMDBr0024392 | Hydrogen Ion | L-Cysteine | Phosphoadenosine 5'-phosphosulfate reductase | | RHEA | 34755880 |
| MMDBr0024411 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024415 | (S)-4-Amino-5-oxopentanoate | Hydrogen Ion | Glutamyl-tRNA reductase | | RHEA | 34755880 |
| MMDBr0024418 | Adenosine triphosphate | diphosphate | Alanine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024424 | S-Adenosylmethionine | S-Adenosylhomocysteine | Protein-L-isoaspartate O-methyltransferase | | RHEA | 34755880 |
| MMDBr0024435 | Deoxyribose 5-phosphate | Acetaldehyde | Deoxyribose-phosphate aldolase | | RHEA | 34755880 |
| MMDBr0024449 | Adenosine triphosphate | diphosphate | Methionine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024459 | Uridine triphosphate | diphosphate | Bifunctional uridylyltransferase/uridylyl-removing enzyme | | RHEA | 34755880 |
| MMDBr0024469 | Geranyl diphosphate | diphosphate | tRNA 2-selenouridine synthase | | RHEA | 34755880 |
| MMDBr0024470 | Geranyl diphosphate | diphosphate | tRNA 2-selenouridine synthase | | RHEA | 34755880 |
| MMDBr0024471 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrA | | RHEA | 34755880 |
| MMDBr0024474 | Adenosine triphosphate | diphosphate | Proline--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024477 | Adenosine triphosphate | diphosphate | CCA-adding enzyme | | RHEA | 34755880 |
| MMDBr0024500 | Glycerol 3-phosphate | CoA | Glycerol-3-phosphate acyltransferase | | RHEA | 34755880 |
| MMDBr0024522 | Adenosine triphosphate | diphosphate | Glycine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024535 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase F | | RHEA | 34755880 |
| MMDBr0024537 | Hydrogen Ion | di-mu-Sulfido-diiron(2+) | Toluene 1,2-dioxygenase system ferredoxin--NAD(+) reductase component | | RHEA | 34755880 |
| MMDBr0024559 | Adenosine triphosphate | Hydrogen Ion | Histidine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024565 | Choline | Betaine aldehyde | Oxygen-dependent choline dehydrogenase | | RHEA | 34755880 |
| MMDBr0024578 | Adenosine triphosphate | diphosphate | Cysteine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024581 | Water | Hydrogen Ion | Cobalamin import ATP-binding protein BtuD | | RHEA | 34755880 |
| MMDBr0024590 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | | RHEA | 34755880 |
| MMDBr0024593 | ADP-alpha-D-glucose | Hydrogen Ion | Probable glycogen synthase | | RHEA | 34755880 |
| MMDBr0024595 | alpha-Ketoglutarate | L-Glutamic acid | Putrescine aminotransferase | | RHEA | 34755880 |
| MMDBr0024596 | alpha-Ketoglutarate | L-Glutamic acid | Putrescine aminotransferase | | RHEA | 34755880 |
| MMDBr0024602 | Adenosine triphosphate | diphosphate | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | | RHEA | 34755880 |
| MMDBr0024612 | Glycerol 3-phosphate | Dihydroxyacetone phosphate | Probable anaerobic glycerol-3-phosphate dehydrogenase subunit B | | RHEA | 34755880 |
| MMDBr0024628 | Adenosine triphosphate | Hydrogen Ion | Phenylalanine--tRNA ligase beta subunit | | RHEA | 34755880 |
| MMDBr0024629 | S-Adenosylmethionine | Hydrogen Ion | tRNA 5-methylaminomethyl-2-thiouridine biosynthesis bifunctional protein MnmC | | RHEA | 34755880 |
| MMDBr0024630 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase A | | RHEA | 34755880 |
| MMDBr0024632 | L-Aspartic acid | diphosphate | Aspartate--tRNA(Asp) ligase | | RHEA | 34755880 |
| MMDBr0024636 | Phosphate | Ribose-1-phosphate | Probable 6-oxopurine nucleoside phosphorylase | | RHEA | 34755880 |
| MMDBr0024644 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrA | | RHEA | 34755880 |
| MMDBr0024649 | Adenosine triphosphate | diphosphate | Glutamine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024656 | Adenosine triphosphate | diphosphate | Arginine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024688 | Acetyl-CoA | CoA | 3-ketoacyl-CoA thiolase | | RHEA | 34755880 |
| MMDBr0024706 | Water | Hydrogen Ion | Hydroxylamine reductase | | RHEA | 34755880 |
| MMDBr0024707 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Biotin synthase | | RHEA | 34755880 |
| MMDBr0024716 | NAD | Hydrogen Ion | Fatty acid oxidation complex subunit alpha | | RHEA | 34755880 |
| MMDBr0024731 | Oxygen | Water | Alkanesulfonate monooxygenase | | RHEA | 34755880 |
| MMDBr0024745 | L-Glutamic acid | diphosphate | Glutamate--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024750 | Water | Hydrogen Ion | GTP cyclohydrolase-2 | | RHEA | 34755880 |
| MMDBr0024751 | lipid II(3−) | Hydrogen Ion | Penicillin-binding protein 2a | | RHEA | 34755880 |
| MMDBr0024755 | Adenosine triphosphate | Hydrogen Ion | N-acetylmannosamine kinase | | RHEA | 34755880 |
| MMDBr0024759 | Adenosine triphosphate | diphosphate | RNA 3'-terminal phosphate cyclase | | RHEA | 34755880 |
| MMDBr0024765 | 7-Aminomethyl-7-carbaguanine | Guanine | Putative queuine tRNA-ribosyltransferase | | RHEA | 34755880 |
| MMDBr0024768 | Water | L-Cysteine | Peptide methionine sulfoxide reductase MsrB | | RHEA | 34755880 |
| MMDBr0024770 | Hydrogen Ion | L-Cysteine | Probable tRNA sulfurtransferase | | RHEA | 34755880 |
| MMDBr0024774 | Hydrogen Ion | Carbon dioxide | Probable glycine dehydrogenase (decarboxylating) subunit 1 | | RHEA | 34755880 |
| MMDBr0024778 | (6S)-10-formyltetrahydrofolic acid | Hydrogen Ion | Methionyl-tRNA formyltransferase | | RHEA | 34755880 |
| MMDBr0024779 | Water | formate | Peptide deformylase 1 | | RHEA | 34755880 |
| MMDBr0024782 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | | RHEA | 34755880 |
| MMDBr0024787 | Adenosine triphosphate | Hydrogen Ion | Threonine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0024789 | Water | Hydrogen Ion | 4-hydroxy-3-methylbut-2-enyl diphosphate reductase | | RHEA | 34755880 |
| MMDBr0024796 | L-Fucose | beta-L-Fucopyranose | L-fucose mutarotase | | RHEA | 34755880 |
| MMDBr0024808 | 1-Deoxy-D-xylulose 5-phosphate | Water | Thiazole synthase | | RHEA | 34755880 |
| MMDBr0024813 | Dimethylallylpyrophosphate | diphosphate | tRNA dimethylallyltransferase | | RHEA | 34755880 |
| MMDBr0024825 | Hydrogen Ion | diphosphate | Bifunctional protein HldE | | RHEA | 34755880 |
| MMDBr0024826 | 2-deoxy-alpha-D-ribose 1-phosphate | Deoxyribose 5-phosphate | Phosphopentomutase | | RHEA | 34755880 |
| MMDBr0024831 | Water | Ammonium | Adenosine deaminase | | RHEA | 34755880 |
| MMDBr0024832 | Water | Ammonium | Adenosine deaminase | | RHEA | 34755880 |
| MMDBr0024834 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone/menaquinone biosynthesis C-methyltransferase UbiE | | RHEA | 34755880 |
| MMDBr0024842 | Hydrogen Ion | Hydrogen Ion | Sialic acid transporter NanT | | RHEA | 34755880 |
| MMDBr0024851 | L-Dihydroorotic acid | orotate | Dihydroorotate dehydrogenase (quinone) | | RHEA | 34755880 |
| MMDBr0024875 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone biosynthesis O-methyltransferase | | RHEA | 34755880 |
| MMDBr0024883 | S-Adenosylmethionine | Hydrogen Ion | S-adenosylmethionine:tRNA ribosyltransferase-isomerase | | RHEA | 34755880 |
| MMDBr0024892 | Water | D-Glucose | Trehalase 1 | | RHEA | 34755880 |
| MMDBr0024957 | Phosphate | 2-deoxy-alpha-D-ribose 1-phosphate | Purine nucleoside phosphorylase | | RHEA | 34755880 |
| MMDBr0024967 | S-Adenosylmethionine | Hydrogen Ion | tRNA (guanine(37)-N1)-methyltransferase Trm5b | | RHEA | 34755880 |
| MMDBr0024971 | L-Threonylcarbamoyladenylate | Hydrogen Ion | tRNA N6-adenosine threonylcarbamoyltransferase | | RHEA | 34755880 |
| MMDBr0024974 | S-Adenosylmethionine | Hydrogen Ion | tRNA-2-methylthio-N(6)-dimethylallyladenosine synthase | | RHEA | 34755880 |
| MMDBr0024977 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein S12 methylthiotransferase RimO | | RHEA | 34755880 |
| MMDBr0025050 | Hydrogen Ion | Carbon dioxide | Putative 8-amino-7-oxononanoate synthase | | RHEA | 34755880 |
| MMDBr0025060 | Adenosine triphosphate | Hydrogen Ion | Type-2 serine--tRNA ligase | | RHEA | 34755880 |
| MMDBr0025063 | S-Adenosylmethionine | Hydrogen Ion | 23S rRNA (uracil(747)-C(5))-methyltransferase | | RHEA | 34755880 |
| MMDBr0025066 | S-Adenosylmethionine | Hydrogen Ion | Demethylmenaquinone methyltransferase | | RHEA | 34755880 |
| MMDBr0025072 | S-Adenosylmethionine | Hydrogen Ion | tRNA (uracil(54)-C(5))-methyltransferase | | RHEA | 34755880 |
| MMDBr0025073 | Water | diphosphate | tRNA 2-selenouridine synthase | | RHEA | 34755880 |
| MMDBr0025074 | Water | diphosphate | tRNA 2-selenouridine synthase | | RHEA | 34755880 |
| MMDBr0025075 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase E | | RHEA | 34755880 |
| MMDBr0025078 | S-Adenosylmethionine | S-Adenosylhomocysteine | Ribosomal RNA small subunit methyltransferase G | | RHEA | 34755880 |
| MMDBr0025079 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase C | | RHEA | 34755880 |
| MMDBr0025081 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase K/L | | RHEA | 34755880 |
| MMDBr0025082 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase G | | RHEA | 34755880 |
| MMDBr0025084 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase B | | RHEA | 34755880 |
| MMDBr0025085 | S-Adenosylmethionine | Hydrogen Ion | Putative ribosomal RNA large subunit methyltransferase H | | RHEA | 34755880 |
| MMDBr0025086 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase F | | RHEA | 34755880 |
| MMDBr0025092 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase M | | RHEA | 34755880 |
| MMDBr0025101 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase I | | RHEA | 34755880 |
| MMDBr0025102 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Ribosomal RNA large subunit methyltransferase N | | RHEA | 34755880 |
| MMDBr0025105 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase H | | RHEA | 34755880 |
| MMDBr0025129 | S-Adenosylmethionine | Hydrogen Ion | tRNA1(Val) (adenine(37)-N6)-methyltransferase | | RHEA | 34755880 |
| MMDBr0025144 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA small subunit methyltransferase J | | RHEA | 34755880 |
| MMDBr0025145 | di-mu-Sulfido-diiron(1+) | 5'-Deoxyadenosine | Probable dual-specificity RNA methyltransferase RlmN | | RHEA | 34755880 |
| MMDBr0025149 | L-Serine | Hydrogen Ion | Isocitrate dehydrogenase kinase/phosphatase | | RHEA | 34755880 |
| MMDBr0025152 | S-Adenosylmethionine | Hydrogen Ion | tRNA/tmRNA (uracil-C(5))-methyltransferase | | RHEA | 34755880 |
| MMDBr0025165 | Phosphate | L-Tyrosine | Bifunctional glutamine synthetase adenylyltransferase/adenylyl-removing enzyme | | RHEA | 34755880 |
| MMDBr0025171 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal RNA large subunit methyltransferase K/L | | RHEA | 34755880 |
| MMDBr0025190 | S-Adenosylmethionine | Hydrogen Ion | Ubiquinone biosynthesis O-methyltransferase | | RHEA | 34755880 |
| MMDBr0025193 | Adenosine triphosphate | ADP | Nucleoside diphosphate kinase | | RHEA | 34755880 |
| MMDBr0025198 | Adenosine triphosphate | diphosphate | Medium/long-chain-fatty-acid--[acyl-carrier-protein] ligase MbtM | | RHEA | 34755880 |
| MMDBr0025205 | L-Lactic acid | Pyruvic acid | L-lactate dehydrogenase | | RHEA | 34755880 |
| MMDBr0025214 | (S)-malate(2-) | Oxalacetic acid | Probable malate:quinone oxidoreductase | | RHEA | 34755880 |
| MMDBr0025215 | ADP | Hydrogen Ion | Putative phosphoenolpyruvate synthase regulatory protein | | RHEA | 34755880 |
| MMDBr0025216 | Hydrogen Ion | NAD | NAD(P)H dehydrogenase (quinone) | | RHEA | 34755880 |
| MMDBr0025217 | Hydrogen Ion | NADP(+) | NAD(P)H dehydrogenase (quinone) | | RHEA | 34755880 |
| MMDBr0025258 | Adenosine triphosphate | Hydrogen Ion | tRNA-specific 2-thiouridylase MnmA | | RHEA | 34755880 |
| MMDBr0025300 | Hydrogen Ion | diphosphate | Putative phosphoenolpyruvate synthase regulatory protein | | RHEA | 34755880 |
| MMDBr0025320 | Adenosine triphosphate | Hydrogen Ion | Lipoate-protein ligase A subunit 1 | | RHEA | 34755880 |
| MMDBr0025326 | Guanosine triphosphate | Hydrogen Ion | Probable GTP 3',8-cyclase | | RHEA | 34755880 |
| MMDBr0025432 | carboxy-S-adenosyl-L-methionine | Hydrogen Ion | tRNA U34 carboxymethyltransferase | | RHEA | 34755880 |
| MMDBr0025490 | S-Adenosylmethionine | Hydrogen Ion | Ribosomal protein L11 methyltransferase | | RHEA | 34755880 |
| MMDBr0025493 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase MntA | | RHEA | 34755880 |
| MMDBr0025494 | Adenosine triphosphate | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025495 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025496 | L-Threonine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025514 | Acetyl-CoA | Malonyl-CoA | Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha | | RHEA | 34755880 |
| MMDBr0025620 | L-Cysteine | Hydrogen Ion | Phosphatidylglycerol--prolipoprotein diacylglyceryl transferase | | RHEA | 34755880 |
| MMDBr0025638 | Adenosine triphosphate | Hydrogen Ion | tRNA-cytidine(32) 2-sulfurtransferase | | RHEA | 34755880 |
| MMDBr0025639 | Adenosine triphosphate | Hydrogen Ion | tRNA-cytidine(32) 2-sulfurtransferase | | RHEA | 34755880 |
| MMDBr0025650 | Hydrogen Ion | Hydrogen Ion | NADH-quinone oxidoreductase subunit C/D | | RHEA | 34755880 |
| MMDBr0025654 | L-Serine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025655 | L-Serine | diphosphate | Protein adenylyltransferase SelO | | RHEA | 34755880 |
| MMDBr0025716 | Hydrogen Ion | (2E)-thiogeraniol | tRNA 2-selenouridine synthase | | RHEA | 34755880 |
| MMDBr0025717 | Hydrogen Ion | (2E)-thiogeraniol | tRNA 2-selenouridine synthase | | RHEA | 34755880 |
| MMDBr0026010 | Cytidine 3'-monophosphate | Cytidine | 5'/3'-nucleotidase SurE | Hydrolysis of nucleotide | RHEA | 34755880 |
| MMDBr0026011 | Guanosine 3'-phosphate | Guanosine | 5'/3'-nucleotidase SurE | Hydrolysis of nucleotide | RHEA | 34755880 |
| MMDBr0026012 | Uridine 3'-phosphate | Uridine | 5'/3'-nucleotidase SurE | Hydrolysis of nucleotide | RHEA | 34755880 |
| MMDBr0026013 | Adenosine 3'-phosphate | Adenosine | 5'/3'-nucleotidase SurE | Hydrolysis of nucleotide | RHEA | 34755880 |
| MMDBr0026022 | Adenosine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026023 | Cytidine monophosphate | Adenosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026024 | Uridine 5'-monophosphate | Uridine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026025 | Guanosine monophosphate | Guanosine | 5'-nucleotidase SurE | Hydrolysis of nucleotide; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026046 | Uridine 5'-diphosphate | Uridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026047 | Uridine 5'-diphosphate | Cytidine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026048 | Guanosine 3',5'-bis(diphosphate) | Guanosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026065 | Cytidine triphosphate | Cytidine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026066 | Uridine triphosphate | Uridine 5'-monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026067 | Adenosine triphosphate | Adenosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026068 | Guanosine triphosphate | Guanosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026073 | Deoxyadenosine monophosphate | Deoxyadenosine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
| MMDBr0026074 | 2'-Deoxyguanosine 5'-monophosphate | Deoxyguanosine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
| MMDBr0026075 | 2'-Deoxyuridine 5'-phosphate | 2'-Deoxyuridine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
| MMDBr0026076 | 2'-Deoxycytidine 5'-phosphate | Deoxycytidine | 5'-nucleotidase SurE 1 | Hydrolysis of nucleotide | RHEA | 34755880 |
| MMDBr0026085 | Deoxyuridine-5'-diphosphate | Deoxyuridine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026086 | 2'-Deoxycytidine 5'-diphosphate | Deoxycytidine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026087 | 2'-Deoxyadenosine 5'-diphosphate | Deoxyadenosine triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026088 | 2'-Deoxyguanosine 5'-diphosphate | 2'-Deoxyguanosine 5'-triphosphate | Nucleoside diphosphate kinase | Phosphorylation | RHEA | 34755880 |
| MMDBr0026089 | Deoxyuridine triphosphate | 2'-Deoxyuridine 5'-phosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026090 | Deoxycytidine 5'-triphosphate | 2'-Deoxycytidine 5'-phosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026091 | Deoxyadenosine triphosphate | Deoxyadenosine monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |
| MMDBr0026092 | 2'-Deoxyguanosine 5'-triphosphate | 2'-Deoxyguanosine 5'-monophosphate | Nucleoside triphosphate pyrophosphatase | Purine metabolism and pyrimidine metabolism; Hydrolysis of pyrophosphate; Dephosphorylation | RHEA | 34755880 |